Kaolin |

Last updated: 18/01/2023
|
 |
(Also known as: argilla; bentone; china clay; porcelain clay; neokaolin ; aluminium silicate hydrate; hydratd aluminium silicate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
Substance with no pesticidal properties but sometimes used in pesticide product formulations to form a barrier film preventing target pests from reaching plant. |
|
Flea beetles; Japanese beetles; Sawflies; Codling moth; Aphids; Weevils; Psyllids; Thrips |
|
Fruit including pears, apples, plums, cherries, grapes, berries; Row field crops |
|
- |
|
- |
|
Current |
|
1997, first registered as pesticide USA |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Greece/France |
|
31/08/2023 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
  |
✓ |
  |
  |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
  |
✓ |
  |
✓ |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
✓ |
  |
  |
  |
  |
  |
  |
|
|
None |
|
H₄Al₂O₉Si₂ |
|
O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
|
- |
|
NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
|
InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;;; |
|
Yes |
|
Insecticide, Repellant, Other substance, Veterinary substance |
|
Coating agent |
|
Inorganic compound |
|
- |
|
- |
|
Natural |
|
Mainly non-toxic mode of action, acts via its physical properties but may also interfere with feeding behaviour and egg-laying |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
1332-58-7 |
|
310-194-1 |
|
None allocated |
|
100104 |
|
56841936 |
|
No data found |
|
258.16 |
|
- |
|
oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate |
|
aluminium silicate hydrate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Off-white coloured powder |
|
|
|
|
|
5.0 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
1760 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Not applicable |
- |
- |
|
Not applicable |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Not applicable |
|
|
- |
- |
- |
|
- |
- |
- |
|
2.6 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Very persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Kaolin is a non-degradable natural component of the environment |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
Kaolin is a natural component of the environment |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 2000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Eisenia foetida> |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
Low |
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 2500 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
> 2500 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 2500 |
Unknown species |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
Poorly absorbed from the gastrointestinal tract, has a short half-life and is nearly all excreted unchanged |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Inhalation may cause pneumoconiosis (Kaolinosis) May produce gastrointestinal disturbances as high doses Possible respiratory sensitiser May cause toxic responses via inhalation |
|
|
|
No information available |
|
Health: H315, H319, H334, H335, H350, H370, H372, H373 |
|
NL (Not listed) |
|
- |
|
- |
|
|
|
kaolin |
|
kaolin |
|
Porzellanerde |
|
kaolin |
|
caolino |
|
caolin |
|
kaoline |
|
- |
|
kaolin |
|
porcelanfold |
|
kaolien |
Record last updated: |
18/01/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |