Citric acid anhydrous |

Last updated: 13/02/2025
|
 |
(Also known as: hydrogen citrate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A naturally occuring acid substance that is used as an insecticide, disinfectant and fungicide and also used in some pesticide formulations as an acidity regulator |
|
Ants; Aphids; Beetles; Mealybugs; Mites |
|
Vegetables; Fruit trees; Ornamentals |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable - not a ppp. May be authorised at national level under different legislation |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
C₆H₈O₇ |
|
C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
|
No data |
|
KRKNYBCHXYNGOX-UHFFFAOYSA-N |
|
InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
citric acid anhydrous |
- |
 |
|
Insecticide; Fungicide; Other substance |
|
Acidity regulator; Microbiocide; Disinfectant; Algicide |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Unclear mode of action likely to be its acidity and sour taste |
|
A component of all citrus fruit |
|
Citric acid is primarily produced commercially through a fermentation process using Aspergillus niger. A. niger is cultured in large bioreactors under controlled conditions, in a fermentation medium containing a carbon source such as molasses or glucose. After the fermentation is complete, the broth is filtered to remove the fungal biomass. The filtrate, which contains citric acid, is then subjected to extraction, purification, drying and formulation. |
|
Crop protection |
|
Ants; Aphids; Beetles; Mealybugs; Mites |
|
Vegetables; Fruit trees; Ornamentals |
|
Suitable for use in all farming systems where approved for use in that country |
|
77-92-9 |
|
201-069-1 |
|
- |
|
021801 |
|
- |
|
192.12 |
|
- |
|
2-hydroxypropane-1,2,3-tricarboxylic acid |
|
3-hydroxypentanedioic acid-3-carboxylic acid |
|
Some applications may be approved under the GB Biocide Products Regulations |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
White crystalline solid |
|
|
|
|
Citric acid |
T.J. Baker |
Sharpshooter |
St. Gabriel |
|
Usually supplied as an aqueous concentrate |
|
|
|
|
|
1330000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
- |
- |
- |
|
153 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.29 X 10-02 |
Calculated |
- |
|
-1.64 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.665 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
3.15 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
Weak acid, pKa(2) = 4.77, pKa(3) = 6.40 |
|
2.21 X 10-06 |
Estimated |
Low volatility |
|
4.36 X 10-09 |
Estimated |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
20 |
R2 R = Peer reviewed scientific publications 2 = Unverified data of unknown source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
DT₅₀ 1-42 days in sludge (R2) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Very mobile |
|
3.1 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 3000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
864 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Carassius auratus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
120 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
640 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Scenedesmus quadricauda |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
> 3000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
May cause gastrointestinal irritation with nausea, vomiting and diarrhoea at high doses |
|
|
|
Prevent generation of dusts |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
citric acid anhydrous |
|
acide citrique |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
13/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |