Farnesene |

Last updated: 15/06/2022
|
 |
(Also known as: beta-farnesene; EBF) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
Alarm pheromone produced by termites and aphids and is also found in some essential oils |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Farnesene refers to 6 related compounds: 4 stereoisomers of the alpha-form and 2 of the beta-form. Two of the alpha-isomers occur in nature with (E,E)-form being the most common. Only the E-form of beta-farnesene occurs naturally. |
|
C₁₅H₂₄ |
|
CC(=CCCC(=CCCC(=C)C=C)C)C |
|
CC(=CCC/C(=C/CCC(=C)C=C)/C)C |
|
JSNRRGGBADWTMC-NTCAYCPXSA-N |
|
InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12+ |
|
Yes |
|
Insecticide, Insect repellent, Semiochemical, Pheromone |
|
Plant and insect derived |
|
>96% |
|
- |
|
Natural |
|
Acts as an attractant to insect predators |
|
Beta farmesene is a consitutuent of various essential oils, an aphid alarm pheromone and is also produced by some plants, including those of the Solanaceae family, as natual insect repellents |
|
Manufactered for crop protection uses |
|
- |
|
Aphids - attracts aphid parasitoids, lacewing (Chrysoperla carnea) |
|
- |
|
- |
|
502-61-4 |
|
242-582-0 |
|
- |
|
- |
|
5281516 |
|
204.35 |
|
- |
|
(6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene |
|
7,11-dimethyl-3-methylene-1,6,10-dodecatriene |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Colourless to pale yellow liquid |
|
|
|
|
None identified |
None identified |
|
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
25 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
110 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
1.48 X 1007 |
Calculated |
- |
|
7.17 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.83 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
1346 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Highly volatile |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Most likely route of exposure is via skin absorption |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
No further information available |
|
|
|
No information available |
|
- |
|
NL (Not listed) |
|
- |
|
- |
|
|
|
farnesene |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
15/06/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |