Copper II carbonate |

Last updated: 15/01/2023
|
 |
(Also known as: cupric carbonate; copper carbonate hydroxide; bremen blue; copper (II) carbonate; dihydroxydicopper carbonate) |
This is an inorganic copper based fungicide. It has a low aqueous solubility and a low volatility. It is highly toxic to fish and earthworms. It is moderately toxic to mammals via the oral route. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An inorganic-copper fungicide, algaecide and insecticide |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
CH₂Cu₂O₅ |
|
C(=O)([O-])[O-].[Cu+2] |
|
- |
|
ZMMDPCMYTCRWFF-UHFFFAOYSA-J |
|
InChI=1S/CH2O3.2Cu.2H2O/c2-1(3)4;;;;/h(H2,2,3,4);;;2*1H2/q;2*+2;;/p-4 |
|
Yes |
|
Fungicide |
|
Inorganic compound |
|
- |
|
- |
|
Natural |
|
Protective, inhibiting fungal spores and pathogens from entering the host tissues. Multi-site activity. |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
12069-69-1 |
|
214-671-4 |
|
44 |
|
- |
|
25503 |
|
No data found |
|
221.1 |
|
- |
|
dicopper carbonate dihyroxide |
|
copper II carbonate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
M01 |
|
- |
|
Green-blue Powder |
|
|
|
|
- |
- |
|
Usually supplied as a spray-dried, powder. Both light and dense grades are available. |
|
|
|
|
|
0.000001 |
Q4 Q = Miscellaneous internet resources 4 = Verified data |
Low |
|
- |
- |
- |
|
200 |
Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.55 X 10-01 |
Calculated |
- |
|
-0.81 |
Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
3.9 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
1.00 X 10-10 |
Q1 Q = Miscellaneous internet resources 1 = Estimated data with little or no verification |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
0.1 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-persistent |
|
0.1 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Copper ion rapidly released in soil. Copper is a naturally occurring element and, as such, does not then degrade further. DT₅₀ of Cu >10,000 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Very mobile |
|
1 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
15 |
Eisenia foetida as Cu 56 days |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 50 |
|
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.017 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
59.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data Chironomus riparius as mg Cu/kg |
Moderate |
|
- |
- |
- |
|
0.55 |
Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Potential heavy metal poisoning Pulmonary and hepatic toxin Harmful if swallowed or inhaled |
|
|
|
Prevent generation of dust |
|
Health: H302, H315, H319 Environment: H400, H410 |
|
NL (Not listed) |
|
- |
|
- |
|
|
|
copper II carbonate |
|
carbonate de cuivre |
|
Kupfercarbonat |
|
cupricarbobat basisk |
|
carbonato di rame |
|
carbonato de cobre |
|
- |
|
weglan miedzi (II) |
|
- |
|
- |
|
- |
Record last updated: |
15/01/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |