Chlortetracycline |

Last updated: 29/03/2022
|
 |
(Also known as: aureomycin ; biomycin ) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
Broad spectrum antibiotic and antimicrobial substance isolated from the micro-organism (treptomyces aureofaciens) used in veterinary products and for aquaculture |
|
- |
|
- |
|
- |
|
- |
|
- |
|
1945, first discovered |
|
- |
|
Not approved |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Isomeric |
|
C₂₂H₂₃ClN₂O₈ |
|
CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O |
|
C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O |
|
DHPRQBPJLMKORJ-XRNKAMNCSA-N |
|
InChI=1S/C22H23ClN2O8/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31)/t7?,8-,15-,21-,22-/m0/s1 |
|
Yes |
|
Bactericide, Fungicide, Antimicrobial, Veterinary substance, Other substance |
|
Wood preservative |
|
Amide pesticide; Tetracycline compound |
|
- |
|
- |
|
Natural |
|
Protein synthesis inhibitor |
|
A tetracycline antibiotic cultured from a soil sample collected from Sanborn Field at the University of Missouri, USA |
|
- |
|
Livestock antibiotic |
|
- |
|
- |
|
- |
|
57-62-5 |
|
200-341-7 |
|
- |
|
006301 |
|
- |
|
478.88 |
|
- |
|
(4S,4aS,5aS,6S,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|
7-chlorotetracycline |
|
Possible groundwater contaminant |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
- |
- |
|
Usually supplied in formualtions for oral administration |
|
|
|
|
|
630 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
High |
|
- |
- |
- |
|
168.5 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.40 X 10-01 |
Calculated |
- |
|
-0.62 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
4.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
- |
|
2.09 X 10-23 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility |
|
4.8 X 10-22 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
30 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature DT₅₀ range >30 days (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1500 |
Mouse |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.89 |
R4 R = Peer reviewed scientific publications 4 = Verified data Unknown species |
Moderate |
|
- |
- |
- |
|
128 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
1.62 |
Lemna gibba |
Moderate |
|
3.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1500 |
Mouse |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
Intraperitoneal LDLo = 335 mg kg⁻¹ |
Rat |
- |
Intravenous LD₅₀ = 118 mg kg⁻¹ |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
Mainly eliminated in the faeces |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
  |
No data found |
No data found |
  |
|
|
No further information available |
|
|
|
No information available |
|
- |
|
NL (Not listed) |
|
- |
|
- |
|
|
|
chlortetracycline |
|
chlortetracycline |
|
- |
|
- |
|
- |
|
clortetraciclina |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
29/03/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |