Cuelure (Ref: ENT 32833 ) |
Last updated: 23/02/2022
|
|
(Also known as: Melon fly pheromone; cue-lure; Raspberry ketone acetate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A volatile substance that is an insect pheromone and used as an attractant |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
1995, first introduced USA |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₁₂H₁₄O₃ |
|
CC(=O)CCC1=CC=C(C=C1)OC(=O)C |
|
No data |
|
UMIKWXDGXDJQJK-UHFFFAOYSA-N |
|
InChI=1S/C12H14O3/c1-9(13)3-4-11-5-7-12(8-6-11)15-10(2)14/h5-8H,3-4H2,1-2H3 |
|
Yes |
|
Insecticide, Insect attractant, Pheromone |
|
Pheromone |
|
>95% |
|
- |
|
Synthetic |
|
Functions as an insect attractant - lure |
|
Synthetic substance that is similar in structure and properties to the natural secretions of the male melon fly (Dacus cucurbitae Coq.) |
|
Synthesised for commerical use |
|
Crop protection |
|
Melon fly (Dacus cucurbitae Coq.) |
|
Melons, cucurbits |
|
Suitable for use in organic farming and for IPM where approved for use in that country |
|
3572-06-3 |
|
222-682-0 |
|
- |
|
128916 |
|
- |
|
206.24 |
|
- |
|
p-(3-oxobutyl)phenyl acetate |
|
4-[4-(acetyloxy)phenyl]-2-butanone |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Volatile colourless to pale yellow coloured liquid |
|
|
|
|
FT-Cuelure Technical Grade |
Farma Tech International Corp., USA |
Splat Curelure |
ISCA Technologies |
Cuelure |
Shanghai Pi Chemicals Ltd |
|
Usually supplied in slow release formulations that are used with in pheromone dispensers |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
123 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
|
- |
- |
- |
|
113 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
1.02 X 1001 |
Calculated |
- |
|
1.01 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.099 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
3038 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
21.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
3038 |
Rat |
Low |
|
2025 |
Rabbit |
- |
|
> 2.9 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No adverse human health effects noted |
|
|
|
Not explosive or oxisiding |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
cuelure |
|
cuelure |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/02/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |