| Octenol |

Last updated: 02/10/2025
|
 |
(Also known as: amylvinylcarbinol; vinyl amy carbinol; mushroom alcohol; matsuica alcohol; 1-octen-3-ol) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
A plant derived insect attractant/repellent used to control mainly flying pests |
|
|
Flies; Bugs; Mosquitoes |
|
|
Non-food situations |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Isomeric existing as two enantiomers: (R)-(–)-1-octen-3-ol and (S)-(+)-1-octen-3-ol. |
|
|
C₈H₁₆O |
|
|
CCCCCC(C=C)O |
|
|
- |
|
|
VSMOENVRRABVKN-UHFFFAOYSA-N |
|
|
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3 |
|
|
Yes |
|
|
Insecticide; Repellent |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Mode of action is unclear but thought to block the insects octenol odorant receptors |
|
|
- |
|
|
Octenol is produced by several plants and fungi, including edible mushrooms, lemon balm |
|
|
Non-food use |
|
|
- |
|
|
3391-86-4 |
|
|
222-226-0 |
|
|
- |
|
|
069037 |
|
|
18827 |
|
|
128.21 |
|
|
- |
|
|
oct-1-en-3-ol |
|
|
3-hydroxy-1-octene |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Colourless, slightly viscous liquid |
|
|
|
|
|
Current |
|
|
1996, first registered USA |
|
|
- AgriSense-BCS Ltd, UK
- Biogents AG, Germany
- Russell IPM, UK
- American Biophysics Corporation
|
|
|
- BG-Lure
- Mosquito Attractant Emitter Strip
- Mosquito Magnet Octenol Cartridge
- Octenol Lure
|
|
|
Usually formulated to use in dispensers, lures and electric bug killing stations |
|
|
Commercial production of octenol typically involves synthetic or biotechnological methods that replicate its natural formation in fungi. Industrially, octenol is produced by the enzymatic breakdown of linoleic acid. This process uses lipoxygenase and hydroperoxide lyase enzymes to convert linoleic acid into octenol and other by-products. In some cases, bioreactors containing crude enzyme homogenates from mushrooms are employed to scale up production efficiently. |
|
|
There is currently no published quantitative GHG emissions data specifically for the production of octenol . However, emissions can be inferred based on its chemical synthesis and usage profile. Data suggests that GHG emissions would be in the range 2 to 4 kg CO₂e per kg of octenol, depending on energy source and process efficiency. This estimate includes raw material extraction, chemical synthesis, solvent use and purification as well as packaging and transport. Biotechnological production offers potential for lower emissions. This involves microbial production using engineered yeast or fungi. If powered by renewable energy and using biogenic feedstocks, emissions could drop to <1.5 kg CO₂e per kg. However, this method is still experimental or small-scale, and not widely adopted commercially. |
|
|
|
|
|
|
|
|
|
|
1836 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source at 25 °C |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
174 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
61.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
4.37 X 1002 |
Calculated |
- |
|
|
2.64 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
340 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
34 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
340 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
3300 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
|
3.72 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
Intravenous LD₅₀ = 56 mg kg⁻¹ |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Mouse |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
- |
|
|
Not listed |
|
|
UN2810 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
octenol |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
02/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.