Maltodextrin |

Last updated: 11/01/2023
|
 |
(Also known as: Grape sugar; Corn sugar) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A plant derived starch that shows broad spectrum activity against sucking and chewing insect pests. Also used in foods and beverages as a thickner and sweetner. |
|
Spider mite, Whitefly, Thrips, leafhoppers, Scale, Mealybug |
|
Soft, top, cane and bush fruit; Brassicas |
|
- |
|
- |
|
Current |
|
- |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
UK |
|
30/09/2023 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
  |
✓ |
✓ |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
  |
✓ |
  |
  |
✓ |
✓ |
  |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
  |
  |
|
|
Nnone |
|
(C₁₂H₂₀O₁₁)n where n= ₁₈-₂₀ |
|
C(C(C(C(C(C=O)O)O)O)O)O |
|
- |
|
- |
|
InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1/i1+2 |
|
Yes |
|
Insecticide, Other substance |
|
Binding agent, Carrier |
|
Polysaccharide insecticide |
|
>91% |
|
EU dossier - none declared |
|
Natural |
|
Mode of action is purely physical, substance coats and dries on target pest blocking the spiracles and leading to death by suffocation. Also has entrapment properties. |
|
Plant sugar |
|
Manufacturred for commercial applications |
|
Horticultural insecticide |
|
Red spider mites; Aphids; Whitefly |
|
Horticultural crops |
|
Organic, IPM |
|
9050-36-6 |
|
232-940-4 |
|
801 |
|
- |
|
162179169 |
|
(240)n |
|
maltodextrin |
|
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|
maltodextrin |
|
Used as a food additive |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Hygroscopic cream to white coloured powder |
|
|
|
|
Eradicoat |
Certis |
Majestik |
Certis |
|
Usually supplied as a soluble concentrate that is mixed with water and used as a foliar spray |
|
|
|
|
|
600000 |
|
High |
|
- |
- |
- |
|
240 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
527 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
287 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
|
6.76 X 10-04 |
Calculated |
- |
|
-3.17 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.581 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Rapidly biodegrades |
|
|
5.0 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature data for soil DT₅₀ varies from <1 day to <60 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2500 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 500 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 200 |
Apis mellifera |
Low |
|
> 200 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 200 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
> 200 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
> 2000 |
Rat |
Low |
|
2000 |
Rat |
- |
|
> 5.16 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
No significant risks identified |
|
No significant risks identified |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
XNo, known not to cause a problem |
  |
|
|
Not consider hazardous at normal doses High consumption may cause gastrointestinal issues |
|
|
|
Avoid reaction with oxidising agents Non-corrosive Explosive under certain conditions; Not oxidising Hygrosccopic Not highly flammable |
|
Not classified |
|
NL (Not listed) |
|
Not regulated |
|
- |
|
|
|
maltodextrin |
|
maltodextrine |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
11/01/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |