Methyleugenol (Ref: Ent 21040) |

Last updated: 28/06/2022
|
 |
(Also known as: methyl eugenol; Eugenol methyl ether; a-allylveratrole; 4-allylveratrole ; NSC 209528; O-methyleugenol) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Chemical transformation product also used as an insect parapheromone used in traps to attract certain species such as the oriental fruit fly |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not approved |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₁₁H₁₄O₂ |
|
COC1=C(C=C(C=C1)CC=C)OC |
|
- |
|
ZYEMGPIYFIJGTP-UHFFFAOYSA-N |
|
InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
Eugenol |
Parent |
 |
|
Metabolite, Insecticide |
|
Soil |
|
Plant derived substance |
|
>98% |
|
<1% Eugenol |
|
Natural |
|
Not applicable |
|
Methyleugenol is a natural plant constituent and a component of several essential oils |
|
Methyleugenol is produced by the methylation of eugenol |
|
- |
|
- |
|
- |
|
- |
|
93-15-2 |
|
202-223-0 |
|
- |
|
- |
|
- |
|
178.23 |
|
- |
|
1,2-dimethoxy-4-prop-2-en-1-ylbenzene |
|
1,2-dimethoxy-4-(2-propenyl)benzene |
|
Registered food additive; FEMA 2475; CoE 185 |
|
- |
|
Not applicable |
|
Not applicable |
|
UNE |
|
Not applicable |
|
- |
|
Colourless to pale yellow liquid |
|
|
|
|
|
500 |
D4 D = Agricultural Research Information System (ARIS) Database 4 = Verified data |
Moderate |
|
- |
- |
- |
|
-2 |
Q4 Q = Miscellaneous internet resources 4 = Verified data |
- |
|
146 |
Q4 Q = Miscellaneous internet resources 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.82 X 1003 |
Calculated |
- |
|
3.45 |
Q4 Q = Miscellaneous internet resources 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.0396 |
Q4 Q = Miscellaneous internet resources 4 = Verified data |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
0.25 |
Q4 Q = Miscellaneous internet resources 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
0.25 |
Q4 Q = Miscellaneous internet resources 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
Shown to rapidly dissipate in soil, 98% lost within 96hrs |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
242.25 |
D4 D = Agricultural Research Information System (ARIS) Database 4 = Verified data Eisenia foetida |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
8.5 |
D4 D = Agricultural Research Information System (ARIS) Database 4 = Verified data Lepomis macrochirus |
Moderate |
|
- |
- |
- |
|
38 |
D4 D = Agricultural Research Information System (ARIS) Database 4 = Verified data Daphnia magna |
Moderate |
|
1.1 |
D4 D = Agricultural Research Information System (ARIS) Database 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
22.0 |
D4 D = Agricultural Research Information System (ARIS) Database 4 = Verified data Pseudokirchneriella subcapitata |
Low |
|
4.6 |
D4 D = Agricultural Research Information System (ARIS) Database 4 = Verified data Pseudokirchneriella subcapitata |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
Possible liver toxicant |
|
|
|
No information available |
|
- |
|
NL (Not listed) |
|
- |
|
- |
|
|
|
methyleugenol |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
28/06/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |