Spearmint oil |
Last updated: 23/11/2023
|
|
(Also known as: p-mentha-6,8-dien-2-one; d-carvone) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A fungicide and plant growth regulator often used as a potato sprouting inhibitor |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
- |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Sweden/Netherlands |
|
31/01/2026 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
  |
  |
✓ |
✓ |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
✓ |
  |
✓ |
✓ |
✓ |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
- |
|
- |
|
- |
|
- |
|
Major consitituent: InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 |
|
Yes |
|
Plant Growth Regulator, Metabolite |
|
Soil, Groundwater |
|
Plant derived substance |
|
- |
|
EU dossier - none declared |
|
Natural; Complex mixture |
|
Inhibits cell growth |
|
Plant oil |
|
Produced commercially for agriculture |
|
Post harvest management |
|
None - PGR |
|
Potatoes |
|
- |
|
8008-79-5 |
|
283-656-2 (spearmint extract) |
|
908 |
|
- |
|
- |
|
- |
|
- |
|
- |
|
Oil, spearmint |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless to pale yellow liquid which is comprised of a complex mixture of botanical substances including L-carvone (~67%), D-limonene (~14%), |
|
|
|
|
|
|
- |
- |
|
Usually supplied in formulations for hot fogging for indoor use only |
|
|
|
|
|
1300 |
at 25 °C |
High |
|
- |
- |
- |
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
92.0 |
|
- |
|
|
2.51 X 1002 |
Calculated |
- |
|
2.4 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.957 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
21328 |
at 25 °C |
Highly volatile |
|
7.83 |
at 25 °C |
Moderately volatile |
|
- |
- |
- |
|
31.13 |
|
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 200 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 20.3 |
Oncorhynchus mykiss as carvone |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 9.59 |
Daphnia magna as carvone |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
4.58 |
Unknown species as carvone |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
> 2000 |
Rat |
Low |
|
2000 |
Rat |
- |
|
> 5.43 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
May cause gastrointestinal tract irritation with nausea, vomiting and diarrhoea |
|
|
|
Not explosve or oxidising |
|
Health: H304, H317 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
spearmint oil |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/11/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |