Isovaleric acid |

Last updated: 29/03/2022
|
 |
(Also known as: delphinic acid; isopentanoic acid; short chain fatty acid; fatty acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A natural fatty acid found in a wide variety of plants and essential oils. It is mainly used as a chemical intermediate to manufacture flavors and perfumes, synthetic lubricants, agricultural chemicals, and pharmaceuticals |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
1997, first evaluated for food applications |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Isomer of valeric acid |
|
C₅H₁₀O₂ |
|
CC(C)CC(=O)O |
|
No data |
|
GWYFCOCPABKNJV-UHFFFAOYSA-N |
|
InChI=1S/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7) |
|
Yes |
|
Other substance |
|
Pesticide intermediate |
|
Carboxylic acid compound |
|
- |
|
- |
|
Natural |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
503-74-2 |
|
207-975-3 |
|
- |
|
- |
|
- |
|
102.13 |
|
- |
|
3-methylbutryic acid |
|
β-methylbutyric acid |
|
Flavouring agent |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless to pale yellow liquid with unpleasant, rancid smell |
|
|
|
|
|
40700 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
High |
|
- |
- |
- |
|
-29.3 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source freezing point |
- |
|
176.5 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
70 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
|
1.45 X 1001 |
Calculated |
- |
|
1.16 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.925 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
4.77 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
> 2000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Low |
|
310 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No information available |
|
|
|
When heated to decomposition it emits acrid smoke and fumes Corrosive Flammable |
|
Handling: H227 Health: H302, H311, H314, H318, H335 |
|
- |
|
3265 |
|
Packaging Group III (minor danger) |
|
|
|
isovaleric acid |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
29/03/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |