Matrine |

Last updated: 01/04/2021
|
 |
(Also known as: alpha-matrine; sophocarpidine) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A natural plant alkaloid, derived from wild medical plants which is active against several pest arthropods |
|
Aphids; Carmine spider mite; Apple & various leaf mites; Leek maggot; Grubs; Wireworms; Cutowrms; Diamondback moth; Caterpillars |
|
Glass house crops; Crucifers |
|
Matrine-based biopesticides have demonstrated acaricidal and insecticidal activity in both field and laboratory studies. |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Isomeric |
|
C₁₅H₂₄N₂O |
|
C1CC2C3CCCN4C3C(CCC4)CN2C(=O)C1 |
|
C1C[C@@H]2[C@H]3CCCN4[C@H]3[C@@H](CCC4)CN2C(=O)C1 |
|
ZSBXGIUJOOQZMP-JLNYLFASSA-N |
|
InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-/m0/s1 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
matrine |
- |
 |
|
Insecticide, Nematicide, Bactericide |
|
Plant derived substance |
|
>98% |
|
- |
|
Natural |
|
Acts on insect pest central nervous system causing breath inhibition and motion imbalance. Curative and preventative. |
|
A natural plant agent, derived from wild medical plants, such as the roots of (i>Sophora flavescens leaves of Pterocarya stenoptera and essential oils from leaves of Platycladus orientalis |
|
- |
|
Crop protection |
|
Aphids; Carmine spider mite; Apple & various leaf mites; Leek maggot; Grubs; Wireworms; Cutowrms; Diamondback moth; Caterpillars |
|
Glasshouse crops |
|
- |
|
519-02-8 |
|
610-750-6 |
|
- |
|
- |
|
- |
|
248.36 |
|
- |
|
matridin-15-one |
|
(7aS,13aR,13bR,13cS)-dodecahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one |
|
Used in Chinese medicine as an anti-inflammatory and widely used to treat diseases such as viral hepatitis, cardiac arrhythmia and skin inflammation. |
|
- |
|
Not applicable |
|
Not applicable |
|
- |
|
Not applicable |
|
- |
|
White crystalline solid |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
77 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
86 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.191 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 10000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
0.0005 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus ignitus & Bombus patagiatus |
High |
B. hypocrita LD₅₀ = 0.002 µg bee⁻¹ |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
> 10000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Low |
|
2000 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Considered safe May exhibit anti-tumour properties |
|
|
|
Combustible - will release toxic gases in a fire |
|
Health: H302, H319, H302 |
|
- |
|
- |
|
- |
|
|
|
matrine |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
01/04/2021 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |