Onion oil |

Last updated: 23/11/2022
|
 |
(Also known as: Oil of Allium cepa L.) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
Oil derived from Allium cepa L. used as an insect repellent |
|
Carrot root fly (psila rosae) |
|
Umbelliferous crops - carrots, celeriac, parsnips, parsley |
|
- |
|
- |
|
Current |
|
- |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
- |
|
Open ended |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
Isomeric |
|
C₇H₁₆ClNO₂ |
|
CCC(C)C(C(=O)OC)N.Cl |
|
CC[C@@H](C)[C@H](C(=O)OC)N.Cl |
|
GGTBEWGOPAFTTH-KGZKBUQUSA-N |
|
InChI=1S/C7H15NO2.ClH/c1-4-5(2)6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H/t5-,6-;/m1./s1 |
|
No |
|
Repellent |
|
Plant derived substance |
|
Food grade quality |
|
EU dossier: none reported |
|
Natural; Complex mixture |
|
Scent masking - aroma originates from plant roots and foliage rich in linoleic, Oleic and Palmitic acids. |
|
Extracted from Allium cepa L. |
|
- |
|
Crop protection |
|
Carrot root fly |
|
Umbelliferous crops - carrots, celeriac, parsnips, parsley |
|
- |
|
8002-72-0 |
|
232-498-2 |
|
- |
|
- |
|
53472027 |
|
181.66 |
|
methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride |
|
methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride |
|
- |
|
Approved via EU & UK 'Basic substance' legislation (Article 28 of Regulation (EC) No 1107/2009); Note Onion Extract is not approved in the EU or UK. |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Oily amber to yellow coloured liquid comprised of various fatty acids dominated by linoleic acid (~65%) |
|
|
|
|
- |
- |
|
Use in oil dispensers |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
41 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.02 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Minimal risks for the public from proposed uses |
|
PPC recommended |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
  |
|
|
Irritant and skin sensitiser |
|
|
|
Flammable liquid Use foam or carbon dioxide in firefighting - not water May produce hazardous organic compounds in a fire Not oxidising agent INDG transport number 3 |
|
Health: H226, H317 Environment: H401, H410 |
|
- |
|
1197 |
|
Packaging group III (low danger) |
|
|
|
onion oil |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/11/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |