Ammonium carbonate |

Last updated: 04/01/2024
|
 |
(Also known as: diammonium carbonate; carbonic acid ammonium salt) |
Ammonium carbonate is an inorganic herbicide, fungicide and biocide. It is non-volatile and highly soluble in water. Ammonium acetate has a low mammalian toxicity and there is some risk of bioaccumulation. It is a recognised irritant. Ecotoxicological data is scarce. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An inorganic herbicide, fungicide and microbiocide sometimes used as the copper salt |
|
Bacterial blight; Eyespot; Leaf spot; Powdery mildew; Net blotch |
|
Walnuts; Cereals including wheat, barley; Tomatoes; Fruit including cherries, apples, bananas; Wood structures |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Germany |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
N₂H₈CO₃ |
|
C(=O)([O-])[O-].[NH4+].[NH4+] |
|
No data |
|
PRKQVKDSMLBJBJ-UHFFFAOYSA-N |
|
InChI=1S/CH2O3.2H3N/c2-1(3)4;;/h(H2,2,3,4);2*1H3 |
|
Yes |
|
Fungicide, Herbicide, Microbiocide, Wood preservative, Biocide |
|
Inorganic compound |
|
- |
|
- |
|
Natural |
|
As a fungicide it is a protectant, inhibiting fungal spores and pathogens from entering the host tissues |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
506-87-6 |
|
208-058-0 |
|
8012 |
|
- |
|
517111 |
|
No data found |
|
96.09 |
|
ammonium carbonate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
None allocated |
|
None allocated |
|
Not applicable |
|
NC |
|
None identified |
|
White powder |
|
|
|
|
|
|
|
10000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
- |
- |
- |
|
- |
- |
- |
|
Decomposes before boiling |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.55 X 10-01 |
Calculated |
- |
|
-0.81 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.5 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
1.00 X 10-10 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low volatility |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Natural substance that rapidly disperses in the environment |
|
|
- |
- |
- |
|
- |
|
|
6.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 1.6-12.0 days, Mandarin undercover grown, various matrices, n=2 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
2150 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
37 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Pimephales promelas |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
2150 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
May cause irritation to the gastrointestinal tract Irritant If inhaled will cause breathing difficulties |
|
|
|
Corrosive Not expected to auto-ignite; Not highly flammable |
|
Health: H302, H315, H319, H335 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
ammonium carbonate |
|
carbonate d'ammonium |
|
Ammoniumcarbonat |
|
ammoniumkarbonat |
|
carbonato di ammonio |
|
carbonato de amonio |
|
- |
|
weglan amonu |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
04/01/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |