Carvacrol |

Last updated: 29/03/2022
|
 |
(Also known as: cymophenol) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A naturally occurring plant phenol which has numerous applications as an insecticide, antimicrobil and as an external animal parasite repellent |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
C₁₀H₁₄O |
|
CC1=C(C=C(C=C1)C(C)C)O |
|
- |
|
RECUKUPTGUEGMW-UHFFFAOYSA-N |
|
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
|
Yes |
|
Insecticide, Acaricide, Veterinary substance, Repellent, Antimicrobial, Fungicide |
|
None |
|
Plant dervived substance |
|
- |
|
- |
|
Natural |
|
Multiple modes of action: carvacrol is a neurotoxin, antagonist of GABA and inhibits acetylcholinesterase |
|
- |
|
- |
|
Public health, Veterinary |
|
Houseflies, Cockroaches, Varroa mite |
|
- |
|
- |
|
499-75-2 |
|
207-889-6 |
|
- |
|
- |
|
10364 |
|
150.22 |
|
2-methyl-5-(propan-2-yl)phenol |
|
2-methyl-5-(propan-2-yl)benzenol |
|
5-Isopropyl-2-methylphenol |
|
FEMA=2245 |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
- |
|
- |
|
Colourless to pale yellow, viscous liquid with a pungent, spicy odour |
|
|
|
|
|
|
|
125 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
1.0 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
238 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
100 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
|
3.09 X 1003 |
Calculated |
- |
|
3.49 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.976 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
810 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
810 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
Moderate |
|
2700 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
No data found |
XNo, known not to cause a problem |
  |
|
|
Carvacrol is bnot a substance of toxicological concern POssible anticarcinogen |
|
|
|
Corrosive Extinguish fires with foam, dry extinguishing powder, carbon dioxide (CO2), water spray jet May emit toxic fumes in a fire Not compatible with strong oxidizers |
|
Health: H302, H314 Environment: H411 |
|
- |
|
3265 |
|
Packaging group III (minor danger) |
|
|
|
carvacrol |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
29/03/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |