Capric acid |

Last updated: 29/03/2022
|
 |
(Also known as: nonanoic acid; fatty acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
  |
|
A naurally occurring fatty acid with multiple plant protection and biocidal applications |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
- |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Greece |
|
31/08/2024 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
  |
  |
  |
✓ |
  |
✓ |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
  |
  |
  |
  |
✓ |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
✓ |
  |
  |
  |
✓ |
  |
✓ |
|
|
None |
|
C₁₀H₂₀O₂ |
|
CCCCCCCCCC(=O)O |
|
- |
|
GHVNFZFCNZKVNT-UHFFFAOYSA-N |
|
InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
capric acid |
- |
 |
|
Insecticide, Acaricide, Herbicide, Plant Growth Regulator, Antimicrobial |
|
Animal derived substance |
|
- |
|
- |
|
Natural |
|
Non-selective, burn-down effect |
|
Capric acid occurs as glycerol ester in animal fats |
|
Produced for commercial applications via the oxidation of the primary alcohol decanol |
|
General weed control; Surface sanisation |
|
Broad range of small weeds; Microbes |
|
Vegetables, Soft fruit, Ornamentals |
|
- |
|
334-48-5 |
|
52627-73-3 |
|
206-376-4 |
|
- |
|
- |
|
2969 |
|
172.27 |
|
decanoic acid |
|
decanoic acid |
|
decabnoic acid |
|
FEMA=2364; Risk of drift |
|
- |
|
None allocated |
|
None allocated |
|
UNM |
|
Not applicable |
|
- |
|
A white crystalline solid with an unpleasant odour |
|
|
|
|
Suppress |
Westbridge |
Homeplate |
Certis Biologicals |
|
- |
|
|
|
|
|
150 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
31.6 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
268.7 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
112.8 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
|
1.23 X 1004 |
Calculated |
- |
|
4.09 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
4.9 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
25 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
  |
|
|
Capric acid is not a substance of toxicological concern when used for plant protection |
|
|
|
When heated to decomposition it emits acrid smoke and irritating fumes |
|
None allocated |
|
- |
|
- |
|
- |
|
|
|
capric acid |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
29/03/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |