Ammonium nonanoate |

Last updated: 06/06/2022
|
 |
(Also known as: ammonium pelargonate; pelargonic acid ammonium salt) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A non-systemic herbicide used for the suppression and control of weeds including those considered troublesome |
|
Annual/perennial weeds including moss, saplings, and tree suckers, grass, vines |
|
Nurseries, greenhouses, landscapes, interiorscapes and non-food areas |
|
- |
|
- |
|
Current |
|
2008, first approval USA |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
C₉H₂₁NO₂ |
|
CCCCCCCCC(=O)[O-].[NH4+] |
|
- |
|
KLIDOSBTXDALBI-UHFFFAOYSA-N |
|
InChI=1S/C9H18O2.H3N/c1-2-3-4-5-6-7-8-9(10)11;/h2-8H2,1H3,(H,10,11);1H3 |
|
Yes |
|
Herbicide, Other substance |
|
Surfactant |
|
Fatty acid ester herbicide |
|
Approx 40.0% by wt |
|
- |
|
Natural |
|
Non-systemic, broad-spectrum contact herbicide. Ammonium nonanoate disrupts plant cell membranes and reduces pH, causing rapid plant cell death/desiccation |
|
A naturally-occurring fatty acid found in a variety of plants and animals. |
|
Commercially synthesised |
|
Area clearance |
|
Annual/perennial weeds including moss, saplings, and tree suckers, grass, vines |
|
Nurseries, greenhouses, landscapes, interiorscapes, non-food areas |
|
Certified organic cropping systems where registered for us |
|
63718-65-0 |
|
- |
|
- |
|
031802 |
|
21902950 |
|
175.27 |
|
ammonium nonanoate |
|
ammonium nonanoate |
|
octane-1-carboxylic acid, ammonium salt |
|
- |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
- |
|
A colourless to pale yellow liquid with a slight fatty acid odour |
|
|
|
|
|
|
Racer Concentrate |
Falcon |
Ortho GroundClear Weed & Grass Killer |
Scotts |
|
Usually formulated as an aqueous solution |
|
|
|
|
|
Miscible |
|
Miscible |
|
- |
- |
- |
|
- |
- |
- |
|
310 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
141.3 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1.0 |
Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature suggests rapid soil degradation - less than one day |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2150 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 18.06 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
> 2150 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No information available |
|
|
|
Non-flammable Not explosive or oxidising |
|
- |
|
- |
|
- |
|
- |
|
|
|
ammonium nonanoate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
06/06/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |