| Calcium propionate |

Last updated: 25/10/2025
|
 |
(Also known as: calcium dipropionate; calcium propionate hydrate) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A naturally occurring substance used as a mold inhibitor by the food industry |
|
|
Shelf-life |
|
|
Bakery and dairy products; Alcoholic drinks; Tobacco |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Not applicable |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₆H₁₀O₄Ca |
|
|
CCC(=O)[O-].CCC(=O)[O-].[Ca+2] |
|
|
- |
|
|
BCZXFFBUYPCTSJ-UHFFFAOYSA-L |
|
|
InChI=1S/2C3H6O2.Ca/c2*1-2-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2 |
|
|
Yes |
|
|
Fungicide; Veterinary substance; Other substance |
|
|
Food additive; Preservative; Bactericide; Antimicrobial |
|
|
Organic salt; Animal-derived substance; Micro-organism derived substance |
|
|
>95% |
|
|
General literature: may contain <50 ppm iron, <10 ppm lead |
|
|
Natural |
|
|
Accumulates in the cell and competes with alanine and other amino acids necessary for the growth of microorganisms |
|
|
Propionic acid naturally occurs in animals and in dairy products in small amounts. It is also produced by micro-organisms on a variety of materials but in very small yields. Occurs naturally in the diet and by the metabolism of some fatty acids. |
|
|
Food shelf-life |
|
|
Fungi; Microorganisms |
|
|
Bakery and dairy products; Alcoholic drinks; Tobacco |
|
|
- |
|
|
4075-81-4 |
|
|
223-795-8 |
|
|
- |
|
|
077701 |
|
|
19999 |
|
|
186.22 |
|
|
calcium propionoate |
|
|
calcium propionoate |
|
|
propanoic acid, calcium salt |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
USA - GRAS status; E282 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White powder with faint odour |
|
|
|
|
|
Current |
|
|
Early 20th century mould inhibitor recognition; Mid 20th century, introduced for livestock; 1970-2000, widespread use; 2013, not approved UK |
|
|
- Titan Biotech Ltd
- Mainchem
- Sihauli Chemicals
|
|
|
|
|
|
Usually supplied as a feed additive, either in powder or granular form, depending on the application |
|
|
Calcium propionate is produced industrially by neutralising propionic acid with a calcium source, typically calcium hydroxide or calcium oxide, in an aqueous medium. This exothermic reaction forms calcium propionate in solution, which is then concentrated and purified. The mixture is often subjected to filtration to remove impurities, followed by spray drying or convection drying to yield a stable powder or granulate form suitable for feed applications. In some methods, methyl propionate may be used as a precursor, undergoing hydrolysis and neutralization under controlled temperature and pH conditions to optimise yield and purity. |
|
|
Based on similar organic salt production models, GHG emissions for calcium propionate are roughly 1.5–3.5 kg CO₂e per kg of product. |
|
|
|
|
|
|
|
|
|
|
490000 |
|
High |
|
|
- |
- |
- |
|
|
382 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.14 X 1000 |
Calculated |
- |
|
|
0.33 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.406 |
|
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
0.07 |
|
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Readily biodegradable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
3920 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 5000 |
Unknown species |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 500 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 500 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Desmodesmus subspicatus |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
3920 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
2.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Mainly eliminated in urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May cause allergic reactions |
|
|
|
|
|
Corrosive When heated to decomposition it emits acrid smoke and irritating fumes Dust may be combustible |
|
|
Heath: H319, H318, H315, H311 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
calcium propionate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
25/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |