Cevadine |

Last updated: 06/06/2025
|
 |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
  |
|
Naturally occurring alkaloid derived from the dried ripe seeds of Sabadilla (Schoenocaulon officinale). Now largely obsolete. |
|
Mainly used to control thrips and other mites but shows some activity against other pests such as harlequin bugs, squash bugs, blister beetles, fleas |
|
Citrus; Avocado; Mangos; Non-food and external areas |
|
- |
|
- |
|
Considered obsolete but may be available in some countries |
|
Circa 1970, introduced |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
A complex molecule with multiple chiral centers |
|
C₃₂H₄₉NO₉ |
|
C/C=C(/C)\C(=O)O[C@H]1CC[C@]2([C@H]3[C@]1(O[C@@]24C[C@]5([C@@H]6CN7C[C@H](CC[C@H]7[C@@]([C@]6([C@H](C[C@]5([C@@H]4CC3)O)O)O)(C)O)C)O)O)C |
|
- |
|
DBUCFOVFALNEOO-HWBIYQLFSA-N |
|
InChI=1S/C32H49NO9/c1-6-18(3)25(35)41-24-11-12-26(4)19-8-9-20-28(37)13-23(34)31(39)21(29(28,38)16-30(20,26)42-32(19,24)40)15-33-14-17(2)7-10-22(33)27(31,5)36/h6,17,19-24,34,36-40H,7-16H2,1-5H3/b18-6-/t17-,19-,20-,21-,22-,23-,24-,26-,27+,28+,29+,30+,31-,32-/m0/s1 |
|
Yes |
|
Insecticide |
|
Plant-derived substance; Alkaloid insecticide |
|
- |
|
- |
|
Natural |
|
Non-systemic. Works by binding to voltage-gated sodium ion channels, preventing their inactivation, which leads to increased nerve excitability and intracellular calcium concentration |
|
The seeds of the Schoenocaulon officinale plant are harvested when they are fully mature. The active compounds, known as sabadilla alkaloids, are extracted from the seeds. This is typically done using solvents to create a concentrated extract. The extract is then purified to remove any impurities and concentrate the active ingredients. The purified extract is formulated into various products. |
|
The seeds of the Schoenocaulon officinale plant are harvested when they are fully mature. The active compounds, known as sabadilla alkaloids, are extracted from the seeds. This is typically done using solvents to create a concentrated extract. The extract is then purified to remove any impurities and concentrate cevadine. |
|
Crop protection |
|
Mainly used to control thrips and other mites but shows some activity against other pests such as harlequin bugs, squash bugs, blister beetles, fleas |
|
Citrus; Avocado; Mangos; Non-food and external areas |
|
- |
|
62-59-9 |
|
200-545-6 |
|
- |
|
- |
|
45006071 |
|
591.73 |
|
4β,12,14,16β,17,20-hexahydroxy-4a,9-epoxycevan-3β-yl [(Z)-2-methylbut-2-enoate] |
|
4β,12,14,16β,17,20-hexahydroxy-4a,9-epoxycevan-3β-yl [(Z)-2-methylbut-2-enoate] |
|
(3β,4α,16β)-4,9-epoxy-cevane-3,4,12,14,16,17,20-heptol 3-[(2Z)-2-methyl-2-butenoate] |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
- |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Highly toxic; can be fatal if consumed or inhaled |
|
|
|
No information available |
|
Health: H300, H310, H315, H319, H330, H335 |
|
- |
|
- |
|
- |
|
- |
|
|
|
cevadine |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
06/06/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |