Polyoxin B |

Last updated: 06/04/2021
|
 |
(Also known as: polyoxim AL) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A microbial fungicide used lawns, top fruit and rice to control various pathogenic fungi including Alternaria spp. and Botrytis spp. |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
1965, first isolated |
|
- |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Spain |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
A chiral molecule |
|
C₁₇H₂₅N₅O₁₃ |
|
C1=C(C(=O)NC(=O)N1C2C(C(C(O2)C(C(=O)O)NC(=O)C(C(C(COC(=O)N)O)O)N)O)O)CO |
|
- |
|
YFZNSPMAOIVQRP-YVKGXWRCSA-N |
|
InChI=1S/C17H25N5O13/c18-6(8(25)5(24)3-34-16(19)32)13(29)20-7(15(30)31)11-9(26)10(27)14(35-11)22-1-4(2-23)12(28)21-17(22)33/h1,5-11,14,23-27H,2-3,18H2,(H2,19,32)(H,20,29)(H,30,31)(H,21,28,33)/t5-,6-,7-,8+,9-,10+,11+,14+/m0/s1 |
|
Yes |
|
Fungicide |
|
Micro-organism derived substance |
|
- |
|
- |
|
Natural |
|
Systemic with protective action, inhibits cell wall biosynthesis |
|
Isolated from the soil bacterium Streptomyces cacaoi var asoensis |
|
Produced by controlled fermentation |
|
Crop protection |
|
Various plant pathogenic fungi including powdery mildews |
|
Top fruit, vegetables and ornamentals |
|
- |
|
19396-06-6 |
|
243-024-9 |
|
- |
|
- |
|
- |
|
507.41 |
|
- |
|
(2S)-2-[[(2S,3S,4S)-2-amino-5-carbamoyloxy-3,4-dihydroxypentanoyl]amino]-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(hydroxymethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]acetic acid |
|
C1=C(C(=O)NC(=O)N1[Cat H]2[Cat at H]([Cat at H]([Cat H](O2)[Cat at H](C(=O)O)NC(=O)[Cat H]([Cat at H]([Cat H](COC(=O)N)O)O)N)O)O)CO |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
19 |
|
- |
|
Brown powder with musty odour |
|
|
|
|
Polyoxin AL |
Kumiai Chemical Industry Co., Ltd. |
|
Usually supplied as a wettable powder, emulsifiable concentrate or soluble granules |
|
|
|
|
|
|
|
2470 |
|
High |
|
13.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
2250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
0.65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
0.65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
|
188 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Decomposes |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.17 X 10-02 |
Calculated |
- |
|
-1.21 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.84 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
pKa(2) 6.9, pKa(3) 9.4 |
|
1.33 X 1005 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Upland conditions, 2 soil types |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Slow |
|
- |
|
|
Stable |
|
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 21000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
48000 |
- |
|
- |
- |
- |
|
2150 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
28.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinidae |
Moderate |
|
- |
- |
- |
|
4.08 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 21000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
750 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
> 2.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
No further information available |
|
|
|
No information available |
|
None allocated at this time |
|
NL (Not listed) |
|
- |
|
- |
|
|
|
polyoxin B |
|
polyoxin B |
|
Polyoxin |
|
polyoxin |
|
polioxin |
|
polioxina |
|
- |
|
polioksyna |
|
- |
|
- |
|
- |
Record last updated: |
06/04/2021 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |