Trimedlure |

Last updated: 16/11/2022
|
 |
(Also known as: mediterranean fruit fly pheromone; TML) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A synthetic pheromone insect attractant used to control fruit flies |
|
Mediterranean fruit flies |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
A complex chiral molecule. The technical material is an isomeric mixture of 8 isomers - 4 trans (A, B1, B2 & C) and 4 cis (V, W, V, Y) forms. Isomer C is the most attractive to Mediterranean fruit flies |
|
C₁₂H₂₁ClO₂ |
|
CC1CC(CCC1C(=O)OC(C)(C)C)Cl |
|
No data |
|
WXTJNIRCHYDKBK-UHFFFAOYSA-N |
|
InChI=1S/C12H21ClO2/c1-8-7-9(13)5-6-10(8)11(14)15-12(2,3)4/h8-10H,5-7H2,1-4H3 |
|
Yes |
|
Pheromone, Insecticide |
|
Pheromone |
|
- |
|
- |
|
Synthetic |
|
Attractant |
|
A synthetic analogue of a natural kairomone |
|
Manufactured for crop protection applications |
|
Crop protection |
|
Mediterranean fruit fly |
|
Mainly used on citrus crops |
|
Suitable for use in organic farming and for IPM where approved for use in that country |
|
12002-53-8 |
|
234-416-0 |
|
8348 |
|
112603 |
|
- |
|
232.75 |
|
- |
|
tert-butyl (+/-)-4(or 5)-chloro-2-methylcyclohexanecarboxylate |
|
1,1-dimethylethyl 4(or 5)-chloro-2-methylcyclohexanecarboxylate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Water-white liquid |
|
|
|
|
|
|
Trimedlure Magnet Plug (BF L076) |
AgriSense |
FT Trimedlure |
FarmaTech |
|
Usually supplied into slow release formulations |
|
|
|
|
|
1000 |
P4 P = Other governments and regulators 4 = Verified data |
High |
|
- |
- |
- |
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.98 X 1004 |
Calculated |
- |
|
4.6 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1 |
|
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slightly mobile |
|
2625 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
4556 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
2000 |
Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
9.6 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
Toxic |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
4556 |
Rat |
Low |
|
2025 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
2.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
No further information available |
|
|
|
No information available |
|
Health: H315, H319 |
|
NL (Not listed) |
|
- |
|
- |
|
|
|
trimedlure |
|
trimedlure |
|
Trimedlur |
|
trimedlure |
|
trimedlure |
|
trimedlure |
|
- |
|
trimedlur |
|
- |
|
- |
|
- |
Record last updated: |
16/11/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |