| S-metolaklor (Ref: CGA 77102) |
![]() |
Usoda v okolju - Ekotoksikologija - Cloveško zdravje - Abecedno kazalo - Domov
Opis: Isomer herbicide mixture used to control grasses and some broad-leaved weeds in a wide range of crops
Uvod: circa 1998
Direktive 1107/2009 (razveljavitvi 91/414):
| Status | Annex 1 |
| Dossier rapporteur/co-rapporteur | Belgium/Netherlands |
| Date inclusion expires | 31/03/2015 |
Odobreno za uporabo (
) or known to be used (
) v sledecih evropskih državah:
AT |
BE |
BG |
CY |
CZ |
DE |
DK |
EE |
EL |
ES |
FI |
FR |
HU |
IE |
IT |
LT |
LU |
LV |
MT |
NL |
PL |
PT |
RO |
SE |
SI |
SK |
UK |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Also registered in: Avstralija
| Vrsta fitofarmacevtskega sredstva | Herbicid | |||
| Snov skupina | Chloroacetamide | |||
| Snov izvora | Sinteticni | |||
| Nacin delovanja | Selective, absorbed through roots and shhots | |||
| CAS RN | 87392-12-9/178961-20-1 | |||
| EC številka | 257-060-8 | |||
| CIPAC številka | 607 | |||
| US EPA kemicni kodo | 108800 | |||
| Kemijska formula | C15H22ClNO2 | |||
| SMILES | ClCC(=O)N(c1c(cccc1CC)C)C(COC)C | |||
| International Chemical Identifier (InChI) | InChI=1/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/t12-/m0/s1 | |||
| Ali je strukturni diagram na voljo/slika? | Da | |||
| Molekulska masa (g mol-1) | 283.79 | |||
| IUPAC Ime | mix of: (aRS,1S)-2-chloro-6'-ethyl-N-(2-methoxy-1-methylethyl)acet-o-toluidide and 20–0% (aRS,1R)-2-chloro-6'-ethyl-N-(2-methoxy-1-methylethyl)acet-o-toluidide | |||
| CAS Ime | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(1S)-2-methoxy-1-methylethyl]acetamide | |||
| Druge informacije | Possible groundwater contaminant | |||
| Herbicide Resistance Classification (HRAC) | Not known | |||
| Insecticide Resistance Classification (IRAC) | Neprimeren | |||
| Fungicide Resistance Classification (FRAC) | Neprimeren | |||
| Fizikalno stanje | Clear straw-coloured liquid | |||
| Related substances & organisms | ||||
Formulations:
Razgradnja:
Key metabolites:
| Metabolit | Srednja Formacija | Ocenjen Delež Maksimalne Pojav | 91/414 Relevantnost ![]() |
|
metolachlor oxanilic acid (Ref: CGA 51202) ![]() |
Tla | 0.109 | Major fraction, Relevant | |
metolachlor ethane sulfonic acid (Ref: CGA 354743) ![]() |
Tla | 0.124 | Major fraction, Relevant | |
Splošno:
Lastnost ![]() |
Vrednost | Vir / Stopnja kakovosti / Ostale informacije ![]() |
Razlaga ![]() |
|
| Sesalci - oralno akutno LD50 (mg kg-1) | 2577 | A5 Podgana | Nizko | |
| Mammals - Dermal LD50 (mg kg-1 body weight) | > 2000 | A5 Rat | - | |
| Mammals - Inhalation LC50 (mg l-1) | > 2.91 | A5 Rat | - | |
| Other Mammal toxicity endpoints | - | - | ||
| ADI - Sprejemljiv dnevni vnos (mg kg-1bw dan-1) | 0.1 | A5 Dog, SF=100 | - | |
| ARfD - Referenca akutnega odmerka (mg kg-1bw dan-1) | Nerazporejen | A5 | - | |
| AOEL - Sprejemljiva stopnja izpostavljenosti - Sistemski (mg kg-1) | 0.15 | A5 Dog, SF=100 | - | |
| Dermalne študije (%) | 3-10 | A5 concentration dependant | - | |
| Direktiva o nevarnih snoveh 76/464 | - | - | - | |
| Meje izpostavljenosti | - | - | - | |
| Exposure Routes | Public | - | ||
| Occupational | - | |||
| Primeri evropskih MRL (mejnih vrednosti ostankov FFS) (mg kg-1) | Vrednost | Cereals, fruit and vegetables: 0.05 | ||
| Opomba | [EU Directive 2007/11/EC provisional limit, February 2007.] For the EU pesticides database click here |
|||
| MAC - najvišja, še sprejemljiva koncentracija v pitni vodi (µg l-1) | - | - | - | |
Vprašanja zdravje:
| Rakotvorna | Mutagena | Endokrini disruptor | Reproduction / development effects | Acetyl cholinesterase inhibitor | Neurotoxicant | Respiratory tract irritant | Skin irritant | Eye irritant |
|
- |
|
|
|
- |
|
|
|
| Vprašanja vezana na zdravje cloveka | [Possible liver toxicant] | |||||||
: Yes, known to cause a problem
: No, known not to cause a problem
: Possibly, status not identified
- : No data
:
| Jezik | Ime |
| Anglešcina | S-metolachlor |
| Francošcina | S-metolachlore |
| Nemšcina | S-Metolachlor |
| Danšcina | S-metolachlor |
| Italijanšcina | S-metolaclor |
| Španšcina | S-metolachloro |
| Gršcina | S-metolachlor |
| Slovenšcina | S-metolaklor |
| Poljšcina | S-metolachlor |
| Švedšcina | - |
| Madžaršcina | S-metolachlor |
| Nizozemšcina | S-metolachloor |
| Zadnja posodobitev: torek 14. maj 2013 Kontakt: aeru@herts.ac.uk |