| piraklostrobin (Ref: BAS 500F) |
![]() |
Usoda v okolju - Ekotoksikologija - Cloveško zdravje - Abecedno kazalo - Domov
Opis: A fungicide used to control major plant pathogens including Septoria tritici, Puccinia spp. and Pyrenophora teres
Uvod: 2000, first reported
Direktive 1107/2009 (razveljavitvi 91/414):
| Status | Annex 1 |
| Dossier rapporteur/co-rapporteur | Germany |
| Date inclusion expires | 31/05/2014 |
Odobreno za uporabo (
) or known to be used (
) v sledecih evropskih državah:
AT |
BE |
BG |
CY |
CZ |
DE |
DK |
EE |
EL |
ES |
FI |
FR |
HU |
IE |
IT |
LT |
LU |
LV |
MT |
NL |
PL |
PT |
RO |
SE |
SI |
SK |
UK |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Also registered in: Avstralija
| Vrsta fitofarmacevtskega sredstva | Fungicid | |||
| Snov skupina | Strobilurin | |||
| Snov izvora | Sinteticni | |||
| Nacin delovanja | Protective and curative action. Respiration inhibitor (QoL fungicide). | |||
| CAS RN | 175013-18-0 | |||
| EC številka | - | |||
| CIPAC številka | 657 | |||
| US EPA kemicni kodo | - | |||
| Kemijska formula | C19H18CIN3O4 | |||
| SMILES | O=C(OC)N(OC)c1ccccc1COc3nn(c2ccc(Cl)cc2)cc3 | |||
| International Chemical Identifier (InChI) | InChI=1/C19H18ClN3O4/c1-25-19(24)23(26-2)17-6-4-3-5-14(17)13-27-18-11-12-22(21-18)16-9-7-15(20)8-10-16/h3-12H,13H2,1-2H3 | |||
| Ali je strukturni diagram na voljo/slika? | Da | |||
| Molekulska masa (g mol-1) | 387.8 | |||
| IUPAC Ime | methyl {2-[1-(4-chlorophenyl)pyrazol-3-yloxymethyl]phenyl}(methoxy)carbamate | |||
| CAS Ime | methyl [2-[[[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]phenyl]methoxycarbamate | |||
| Druge informacije | - | |||
| Herbicide Resistance Classification (HRAC) | Neprimeren | |||
| Insecticide Resistance Classification (IRAC) | Neprimeren | |||
| Fungicide Resistance Classification (FRAC) | 11 | |||
| Fizikalno stanje | White to light beige crystalline solid | |||
| Related substances & organisms | ||||
Formulations:
Razgradnja:
Key metabolites:
| Metabolit | Srednja Formacija | Ocenjen Delež Maksimalne Pojav | 91/414 Relevantnost ![]() |
|
1-(4-chlorophenyl)-3-({2 [ (methoxy carbonyl)amino] benzyl} oxy)-1H-pyrazol-3-yl]glucopyranosiduronic acid (Ref: BAS 500-6) ![]() |
Tla | 0.310 | Major fraction, Relevant | |
methyl N-(2{[1-(4-chlorophenyl)-1H-pyrazol-3-yl] oxymethyl} phenyl)carbamate (Ref: BAS 500-7) ![]() |
Tla | 0.130 | Major fraction, Relevant | |
Other known metabolites:
| Metabolite name and reference | Aliases | Srednja Formacija / Rate | Ocenjen Delež Maksimalne Pojav | Metabolising Enzymes |
| (Ref: BF500-11) | - | Water; Sediment | - | - |
| (Ref: BF500-13) | - | Water; Sediment | - | - |
| (Ref: BF500-14) | - | Water; Sediment | - | - |
| (Ref: BF500-16) | - | Animal | - | - |
| methyl-N-[[[1-(4-chlorophenyl)-pyrazol-3-yl]oxy]-o-tolyl]carbamate (Ref: BF500-3) |
500M07 | a = Soil (Anerobic); b = Water (Photolysis); c= rat; d = Animal; e = Plant | a=0.958; b=0.180 | - |
| 1 -(4-chloropheny1)-1H-pyrazol-3-ol (Ref: BF500-5) |
500M04 | Rat; Plant; Animal | - | - |
| (Ref: BF500-6) | - | a = Water (Photolysis); b = Animal | a=0.178 | - |
| 1-(4-chloro-2-hydroxyphenyl)-1H-pyrazol-3-ol (Ref: BF500-8) |
- | Animal | - | - |
Splošno:
Lastnost ![]() |
Vrednost | Vir / Stopnja kakovosti / Ostale informacije ![]() |
Razlaga ![]() |
|
| Sesalci - oralno akutno LD50 (mg kg-1) | > 5000 | A5 Podgana | Nizko | |
| Mammals - Dermal LD50 (mg kg-1 body weight) | > 2000 | A5 Rat | - | |
| Mammals - Inhalation LC50 (mg l-1) | 0.69 | A5 Rat | - | |
| Other Mammal toxicity endpoints | - | - | ||
| ADI - Sprejemljiv dnevni vnos (mg kg-1bw dan-1) | 0.03 | A5 Rat, SF=100 | - | |
| ARfD - Referenca akutnega odmerka (mg kg-1bw dan-1) | 0.03 | A5 Rabbit, SF=100 | - | |
| AOEL - Sprejemljiva stopnja izpostavljenosti - Sistemski (mg kg-1) | 0.015 | A3 Rabbit, SF=100 | - | |
| Dermalne študije (%) | 1.0 | A5 | - | |
| Direktiva o nevarnih snoveh 76/464 | - | - | - | |
| Meje izpostavljenosti | - | - | - | |
| Exposure Routes | Public | [No unacceptable risks to bystanders identified] | ||
| Occupational | [No unacceptable risks to operators or other workers identified] | |||
| Primeri evropskih MRL (mejnih vrednosti ostankov FFS) (mg kg-1) | Vrednost | Lettuce and wine grapes: 2.0; Table grapes and citrus: 1.0; Sweet peppers and strawberries: 0.5; Pomes and barley grains: 0.3; Brussel sprouts, cabbages, onions, garlic, eggplants, tomatoes, apricots, cherries, nectarines and peaches: 0.2; Broccoli, cauliflowers, carrots, plums, rye grains and wheat grains: 0.1; Other vegetables, other fruit and corn grain: 0.02 | ||
| Opomba | [Current May 2007.] For the EU pesticides database click here |
|||
| MAC - najvišja, še sprejemljiva koncentracija v pitni vodi (µg l-1) | - | - | - | |
Vprašanja zdravje:
| Rakotvorna | Mutagena | Endokrini disruptor | Reproduction / development effects | Acetyl cholinesterase inhibitor | Neurotoxicant | Respiratory tract irritant | Skin irritant | Eye irritant |
|
- |
- |
|
|
|
|
|
|
| Vprašanja vezana na zdravje cloveka | [No further information available] | |||||||
: Yes, known to cause a problem
: No, known not to cause a problem
: Possibly, status not identified
- : No data
:
| Jezik | Ime |
| Anglešcina | pyraclostrobin |
| Francošcina | pyraclostrobine |
| Nemšcina | Pyraclostrobin |
| Danšcina | pyraclostrobin |
| Italijanšcina | pyraclostrobin |
| Španšcina | piraclostrobina |
| Gršcina | - |
| Slovenšcina | piraklostrobin |
| Poljšcina | pyraklostrobina |
| Švedšcina | pyraklostrobin |
| Madžaršcina | - |
| Nizozemšcina | pyraclostrobin |
| Zadnja posodobitev: cetrtek 2. avgust 2012 Kontakt: aeru@herts.ac.uk |