Hydroprene (Ref: OMS 1696) |

Last updated: 03/09/2023
|
 |
(Also known as: SAN 814; ZR 512; RS-hydroprene; Gencor) |
Hydroprene is an amenity and domestic insecticide. It has a low aqueous solubility, is quite volatile and, based on its chemical properties, it is slightly mobile but unlikely to leach to groundwater. It is not generally persistent in soil systems. It has a low mammalian toxicity. It shows a moderate level of toxicity to fish and daphnia but is relatively non-toxic to adult honeybees but may be harmful to bee larvae. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Used mainly for the control of insects in buildings and food handling establishments but also has some domestic applications |
|
Cockroaches, Beetles, Moths |
|
Non-cropped areas; Public hygiene applications |
|
- |
|
- |
|
1984, first registered USA |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Hydroprene is a chiral molecule and has both geometrical and optical isomers. The technical material is an isomeric mixture. The S enantiomer is the most biologically active. |
|
C₁₇H₃₀O₂ |
|
CCOC(=O)C=C(C)C=CCC(C)CCCC(C)C |
|
CCOC(=O)/C=C(\C)/C=C/CC(C)CCCC(C)C |
|
FYQGBXGJFWXIPP-UEVLXMDPSA-N |
|
InChI=1S/C17H30O2/c1-6-19-17(18)13-16(5)12-8-11-15(4)10-7-9-14(2)3/h8,12-15H,6-7,9-11H2,1-5H3/b12-8+,16-13+ |
|
Yes |
|
Insecticide, Insect Growth Regulator |
|
Unclassified pesticide |
|
- |
|
- |
|
Synthetic |
|
A juvenile hormone mimic. Contact and stomach action, acts by duplicating the action of juvenile hormones keeping the insect in an immature state |
|
41096-46-2 |
|
41205-09-8 |
|
No data found |
|
None allocated |
|
486300 |
|
5372477 |
|
No data found |
|
266.4 |
|
rac-ethyl (2E,4E,7R)-3,7,11-trimethyldodeca-2,4-dienoate |
|
ethyl (E,E)-(RS)-3,7,11-trimethyldodeca-2,4-dienoate |
|
ethyl (2E,4E)-3,7,11-trimethyl-2,4-dodecadienoate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
7A |
|
Not applicable |
|
None identified |
|
Amber coloured liquid |
|
|
|
|
|
|
|
- Mator 2E
- Mator Plus
- Gentrol
- gencor
|
|
Available as an aerosol or emulsifiable concentrate |
|
|
|
|
|
0.54 |
|
Low |
|
- |
- |
- |
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
174 |
|
- |
|
- |
- |
- |
|
148 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
5.62 X 1003 |
Calculated |
- |
|
3.75 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.866 |
|
- |
|
- |
- |
- |
- |
|
40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
46.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
5 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature states DT₅₀ in soil is a few days. |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
2 |
|
Moderately fast |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slightly mobile |
|
610 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.85 |
Calculated |
Low leachability |
|
|
3.76 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 1000 |
Apis mellifera |
Low |
|
0.1 |
Apis mellifera |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.5 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.13 |
Daphnia magna |
Moderate |
|
0.05 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
6350 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
> 5000 |
Rat |
Low |
|
5000 |
Rat |
- |
|
> 5.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
Acute percutaneous LD₅₀ > 5100 mg kg⁻¹ |
Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Probable kidney, liver and gastrointestinal toxicant |
|
|
|
Highly volatile IMGD Transport Hazard Class 9 Not compatible with oxidising agents |
|
Health: H319, H331 Environment: H400 |
|
U (Unlikely to present an acute hazard) |
|
UN3082 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
hydroprene |
|
- |
|
- |
|
- |
|
- |
|
hidropreno |
|
- |
|
hydropren |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
03/09/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |