Dichlormid |

Last updated: 01/11/2024
|
 |
(Also known as: diallyldichloroacetamide; BRN 1768843) |
Dichlormid is a safener used with maize to protect from chloroacetanilide and thiocarbamate herbicides. It is highly soluble in water and is highly volatile. It is not usually persistent in soils. Dichlormid has a moderate mammalian toxicity with a high potential for bioaccumulation. It is also an irritant. It is relatively non-toxic to birds, fish and aquatic invertebrates. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide safener that protects maize against injury from chloroacetanilide and thiocarbamate herbicides |
|
Current |
|
1972, first product launch |
|
Not applicable |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
C₈H₁₁Cl₂NO |
|
C=CCN(CC=C)C(=O)C(Cl)Cl |
|
No data |
|
YRMLFORXOOIJDR-UHFFFAOYSA-N |
|
InChI=1S/C8H11Cl2NO/c1-3-5-11(6-4-2)8(12)7(9)10/h3-4,7H,1-2,5-6H2 |
|
Yes |
|
Other substance |
|
Herbicide safener |
|
Unclassified substance |
|
- |
|
- |
|
Synthetic |
|
Absorbed by plant roots |
|
37764-25-3 |
|
253-658-8 |
|
None allocated |
|
900497 |
|
- |
|
208.09 |
|
2,2-dichloro-N,N-di(prop-2-en-1-yl)acetamide |
|
N,N-diallyl-2,2-dichloroacetamide |
|
2,2-dichloro-N,N-di-2-propenylacetamide |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Clear viscous liquid |
|
|
|
|
|
5000 |
|
High |
|
15000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Kerosene |
- |
|
5.5 |
|
- |
|
Decomposes before boiling |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
6.92 X 1001 |
Calculated |
- |
|
1.84 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.17 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
800 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
7 |
|
Non-persistent |
|
- |
- |
- |
|
8 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature DT₅₀ < 10 days; Other sources: DT₅₀ 7 days (US3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Mobile |
|
40 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.17 |
Calculated |
Transition state |
|
|
2.47 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
7.0 |
Rat |
High |
|
- |
- |
|
- |
- |
- |
|
> 5200 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
141.0 |
Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
161.0 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
Rat |
Low |
|
5000 |
Rat |
- |
|
5.5 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
Not expected to auto-ignite; Not highly flammable |
|
Health: H302, H315, H332 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
dichlormid |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
dichlormid |
|
- |
|
diklormid |
|
- |
|
- |
Record last updated: |
01/11/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |