Metofluthrin (Ref: S 1264) |

Last updated: 23/08/2024
|
 |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Mainly used as a mosquito repellent impregnated on to paper strips and positioned in outdoor areas |
|
Mosquitoes |
|
Gardens; Campsites; Patios |
|
- |
|
- |
|
2004, introduced Japan |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
The technical material of chiral metofluthrin is an unspecified mix of the eight possible isomers with the major isomer normally accounting for at least 80% of the mixture - the material tends to be named after this one isomer. |
|
C₁₈H₂₀F₄O₃ |
|
CC=CC1C(C1(C)C)C(=O)OCC2=C(C(=C(C(=C2F)F)COC)F)F |
|
C/C=C/C1C(C1(C)C)C(=O)OCC2=C(C(=C(C(=C2F)F)COC)F)F |
|
KVIZNNVXXNFLMU-UHFFFAOYSA-N |
|
InChI=1S/C18H20F4O3/c1-5-6-11-12(18(11,2)3)17(23)25-8-10-15(21)13(19)9(7-24-4)14(20)16(10)22/h5-6,11-12H,7-8H2,1-4H3 |
|
Yes |
|
Insecticide, Semiochemical |
|
Pyrethroid ester insecticide; Pyrethroid insecticide |
|
- |
|
- |
|
Synthetic |
|
Vapour active, knock-down action. Sodium channel modulator. |
|
240494-70-6 |
|
No data found |
|
None allocated |
|
109709 |
|
5282227 |
|
No data found |
|
360.34 |
|
At least 80%: [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1E,3E)-2,2-dimethyl-3-[(1E)-prop-1-en-1-yl]cyclopropane-1-carboxylate |
|
At least 80%: 2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl (EZ)-(1RS,3RS;1RS,3SR)-2,2-dimethyl-3-prop-1-enylcyclopropanecarboxylate |
|
At least 80%: [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(1-propenyl)cyclopropanecarboxylate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
3A |
|
Not applicable |
|
- |
|
Pale yellow liquid |
|
|
|
|
|
|
|
0.67 |
|
Low |
|
303400 |
Acetone |
- |
312200 |
Methanol |
- |
307600 |
Ethyl acetate |
- |
326900 |
Toluene |
- |
|
-54 |
|
- |
|
334 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
110 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
1.07 X 1005 |
Calculated |
- |
|
5.03 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.21 |
|
- |
|
- |
- |
- |
- |
|
1.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data 25°C |
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
4.5 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Aerobic DT₅₀ 1-8 days sandy loam |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
6.0 |
|
Moderately fast |
|
DT₅₀ 6 days at pH 4 |
|
|
Stable |
|
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-mobile |
|
5199 |
|
Koc range 4489-7187 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.19 |
Calculated |
Low leachability |
|
|
2.67 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
2250 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
1.2 |
Oncorhynchus mykiss |
Moderate |
|
0.00071 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
0.0047 |
Daphnia magna |
High |
|
0.003 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
Rat |
Low |
|
2000 |
Rat |
- |
|
1.08 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Liver toxicant US EPA - possible human carcinogen at high doses |
|
|
|
No information available |
|
Health: H302, H332, H370, H373 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
metofluthrin |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |