Triflusulfuron |

Last updated: 18/12/2024
|
 |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A post-emergence herbicide for the control many annual and perennial broad-leaved weeds, normally used as the methyl variant |
|
Black bindweed; Charlock; Chickweed; Cleavers; Fathen; Field pansy; Fools parsley, Knotgrass; Redshank; Volunteer rape |
|
Sugarbeet; Fodder beet; Mangolds |
|
- |
|
Current |
|
1983, first registered |
|
Approved |
|
31/12/2028 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
France/Denmark |
|
- |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
✓ |
|
|
|
✓ |
|
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
✓ |
|
|
|
|
✓ |
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
✓ |
|
✓ |
|
|
|
|
None |
|
C₁₆H₁₇F₃N₆O₆S |
|
CC1=CC=CC(=C1S(=O)(=O)NC(=O)NC2=NC(=NC(=N2)OCC(F)(F)F)N(C)C)C(=O)O |
|
- |
|
AKTQJCBOGPBERP-UHFFFAOYSA-N |
|
InChI=1S/C16H17F3N6O6S/c1-8-5-4-6-9(11(26)27)10(8)32(29,30)24-14(28)21-12-20-13(25(2)3)23-15(22-12)31-7-16(17,18)19/h4-6H,7H2,1-3H3,(H,26,27)(H2,20,21,22,23,24,28) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
|
Herbicide |
|
Sulfonylurea herbicide; Triazinylsulfonylurea herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, inhibits amino acid sysnthesis. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
135990-29-3 |
|
No data found |
|
731 |
|
- |
|
86416 |
|
No data found |
|
478.41 |
|
2-({[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoic acid |
|
2-[4-dimethylamino-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-ylcarbamoylsulfamoyl]-m-toluic acid |
|
2-(((((4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl)amino)carbonyl)amino)sulfonyl)-3-methylbenzoic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
|
|
Normally formulated using the methyl variant. |
|
|
|
|
|
1.0 |
at 25 °C |
Low |
|
- |
- |
- |
|
161.5 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.26 X 1003 |
Calculated |
- |
|
3.1 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
4.4 |
|
- |
Weak acid |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
6.5 |
|
Non-persistent |
|
6.5 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
EU dossier data as methyl variant |
|
|
- |
- |
- |
|
- |
|
|
1.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 0.04-3.33days, leaves of 5 plants/crops grown undercover |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
- |
|
Mobile |
|
60 |
|
- |
|
Data as methyl variant |
|
- |
|
|
|
|
|
1.81 |
Calculated |
Transition state |
|
|
8.80 X 10-03 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
Colinus virginianus as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
|
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
730 |
Oncorhynchus mykiss as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
960 |
Daphnia magna as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.04 |
|
- |
|
1.2 |
|
- |
|
- |
- |
- |
|
0.04 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
May affect body weight and food intake Possible liver toxicant CLP data - suspected carcinogen |
|
|
|
No information available |
|
Health: H351 Environment: H400, H410 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
triflusulfuron |
|
triflusulfuron |
|
Triflusulfuron |
|
triflusulfuron |
|
triflusulfuron |
|
triflusulfuron |
|
- |
|
triflusulfuron |
|
triflusulfuron |
|
triszulfuron |
|
- |
|
- |
Record last updated: |
18/12/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |