Difenoxuron (Ref: C3470) |

Last updated: 23/01/2025
|
 |
(Not known by any other names) |
Difenoxuron is a selective, post-emergence herbicide. It has a moderate aqueous solubility, moderately mobile but not usually persistent in soil systems. However, it may persist in some water systems depending upon conditions. It is moderately toxic to mammals but knot known to cause any chronic health issues unless ingested at very high doses. It is moderately toxic to fish, aquatic invertebrates and algae. It is not considered to be toxic to honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete selective, post-emergence herbicide that was used to control annual broad-leaved weeds in alliums. |
|
Nettles; Docks; Chickweed; Charlock |
|
Onions; Garlic; Shallots; Leeks |
|
- |
|
Considered obsolete but may be available in some countries |
|
1964, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₆H₁₈N₂O₃ |
|
CN(C)C(=O)NC1=CC=C(C=C1)OC2=CC=C(C=C2)OC |
|
No data |
|
AMVYOVYGIJXTQB-UHFFFAOYSA-N |
|
InChI=1S/C16H18N2O3/c1-18(2)16(19)17-12-4-6-14(7-5-12)21-15-10-8-13(20-3)9-11-15/h4-11H,1-3H3,(H,17,19) |
|
Yes |
|
Herbicide |
|
Phenylurea herbicide; Urea herbicide |
|
- |
|
- |
|
Synthetic |
|
Inhibition of photosynthesis, absorbed by roots and translocated. |
|
14214-32-5 |
|
238-068-0 |
|
None allocated |
|
551400 |
|
26576 |
|
No data found |
|
286.33 |
|
N'-[4-(4-methoxyphenoxy)phenyl]-N,N-dimethylurea |
|
3-[4-(4-methoxyphenoxy)phenyl]-1,1-dimethylurea |
|
N'-[4-(4-methoxyphenoxy)phenyl]-N,N-dimethylurea |
|
- |
|
- |
|
C2 |
|
5 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystalline solid |
|
|
|
|
|
|
|
Usually supplied as a wettable powder |
|
|
|
|
|
|
|
20 |
|
Moderate |
|
156000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
63000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
8000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
138 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.58 X 1002 |
Calculated |
- |
|
2.2 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.19 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
1.20 X 1003 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
1.28 X 10-07 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
18 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Lierature data DT₅₀ 10-20 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
0.12 |
|
Fast |
|
- |
|
|
950 |
|
Very persistent |
|
- |
|
56 |
|
Moderately fast |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Moderately mobile |
|
199 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.14 |
Calculated |
Transition state |
|
|
7.21 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
29 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
Non-toxic |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-toxic |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
10.7 |
Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
79 |
Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.03 |
Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1000 |
Rat |
Moderate |
|
2150 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
> 0.66 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk to Europeans as no longer approved for use |
|
Low risk to Europeans as no longer approved for use |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H302, H331 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
difenoxuron |
|
difenoxuron |
|
Difenoxuron |
|
difenoxuron |
|
difenoxuron |
|
difenoxuron |
|
- |
|
difenoksuron |
|
- |
|
- |
|
difenoxuron |
|
- |
Record last updated: |
23/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |