Clacyfos (Ref: HW02) |

Last updated: 05/02/2025
|
 |
(Also known as: lvxiancaolin; lüxiancaolin) |
Clacfos is an organophosphate herbicide. Little data has been published regarding its environmental fate, ecotoxicity or its impact on human health. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An organophosphate herbicide and complex ester of 2,4-D used to control many common weeds in some cereals and other crops which is predominately used in China |
|
Annual and perennial broad-leaf weeds and sedges indluding tumbleweed (Amaranthus retroflexus,), acalypha spp. and Abution spp. |
|
Maize; Wheat; Turf & lawns; Orchards; Tea |
|
- |
|
Current |
|
2007, China; 2009, introduced Japan |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Substance is racemic. |
|
C₁₂H₁₅Cl₂O₆P |
|
CC(OC(=O)COC1=C(C=C(C=C1)Cl)Cl)P(=O)(OC)OC |
|
- |
|
UUHXXNQVWVFJLW-UHFFFAOYSA-N |
|
InChI=1S/C12H15Cl2O6P/c1-8(21(16,17-2)18-3)20-12(15)7-19-11-5-4-9(13)6-10(11)14/h4-6,8H,7H2,1-3H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
2,4-D |
Parent component |
 |
|
Herbicide |
|
Organophosphate herbicide; Phenoxyacetic herbicide |
|
- |
|
- |
|
Synthetic |
|
Competitive inhibitor of plant pyruvate dehydrogenase (PHDc) |
|
215655-76-8 |
|
No data found |
|
None allocated |
|
Not listed |
|
53242358 |
|
No data found |
|
375.12 |
|
rac-(1R)-1-(dimethoxyphosphoryl)ethyl (2,4-dichlorophenoxy)acetate |
|
dimethyl [(1RS)-1-(2,4-dichlorophenoxyacetoxy)ethyl]phosphonate |
|
1-(dimethoxyphosphinyl)ethyl 2-(2,4-dichlorophenoxy)acetate |
|
PAN Bad Actor Chemical |
|
- |
|
Not known |
|
Notknown |
|
Not applicable |
|
Not applicable |
|
None identified |
|
Pale yellow liquid |
|
|
|
|
|
970 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate |
|
Miscible |
R4 R = Peer reviewed scientific publications 4 = Verified data Acetone |
- |
Miscible |
R4 R = Peer reviewed scientific publications 4 = Verified data Ethanol |
- |
Miscible |
R4 R = Peer reviewed scientific publications 4 = Verified data Chloroform |
- |
Miscible |
R4 R = Peer reviewed scientific publications 4 = Verified data Toluene |
- |
|
- |
- |
- |
|
195 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
250 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.371 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
- |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Slightly mobile |
|
2000 |
|
- |
|
Literature data: Kf range 103.3-673.0 mL g⁻¹, Kfom range 976.57-10,200 mL g⁻¹ |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
IARC Group 2B carcinogen |
|
|
|
Store in the dark under cool conditions |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
clacyfos |
|
clacyfos |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
05/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |