Clofibric acid |

Last updated: 23/01/2025
|
 |
(Also known as: clofibrinic acid) |
Clofibric acid is an obsolete plant growth regulator. It is moderately soluble in water. Little has been published regarding its toxicity to fauna and flora. It has a moderate mammalian toxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete anti-auxin plant growth regulator used for fruit setting and thining |
|
Growth |
|
Fruit |
|
- |
|
Considered obsolete but may be available in some countries |
|
1967, first approved USA |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₀H₁₁ClO₃ |
|
CC(C)(C(=O)O)OC1=CC=C(C=C1)Cl |
|
- |
|
TXCGAZHTZHNUAI-UHFFFAOYSA-N |
|
InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
clofibric acid |
- |
 |
|
Plant Growth Regulator, Herbicide |
|
Auxin PGR |
|
>98% |
|
- |
|
Synthetic |
|
Auxin-transport inhibitor |
|
882-09-7 |
|
212-925-9 |
|
None allocated |
|
- |
|
2797 |
|
No data found |
|
214.65 |
|
2-(4-chlorophenoxy)-2-methylpropanoic acid |
|
2-(4-chlorophenoxy)-2-methylpropanoic acid |
|
2-(4-chlorophenoxy)-2-methylpropanoic acid |
|
Potential groundwater pollutant |
|
- |
|
P |
|
19 |
|
Not applicable |
|
Not applicable |
|
- |
|
White to pale yellow coloured solid |
|
|
|
- |
|
- Obsolete - not thought to be commercially available for crop protection applications
|
|
- |
|
|
|
|
|
583 |
|
Moderate |
|
50000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Methanol |
- |
50000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Chloroform |
- |
50000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Ethanol |
- |
|
118 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
324.1 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.72 X 1002 |
Calculated |
- |
|
2.57 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
3.18 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source predicted |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
897 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 200 |
Ceriodaphnia dubia |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
897 |
Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
Subcutaneous LD₅₀ = 683 mg kg⁻¹ |
Mouse |
- |
Intraperitoneal LD₅₀ = 290 mg kg⁻¹ |
Mouse |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Reduces human cholesterol at controlled doses Harmful by ingestion or inhalation |
|
|
|
IMDG Transport Hazard Class 9 Store at Room Temperature. Store under Desiccating conditions |
|
Health: H302, H317 |
|
Not listed (Not listed) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
clofibric acid |
|
acide clofibrique |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |