Potassium fulvate |

Last updated: 29/01/2025
|
 |
(Also known as: eco-fulvate; K-fulvate; potassium yellow humic acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
|
|
The potassium salt of fulvic acid shown to improve plant nutrient use and enhance crop growth. It has no pesticidal activity. Dervived mainly from Leonardite which is formed by the decay of plants and animal matter |
|
Growth; Vigour; Yield |
|
All agricultural crops; Lawns and sports turf; Ornamentals |
|
Extensively studied in both the field and lab. Shown to have a role in both plant growth and soil function. Clear evidence demonstrates enhancement of physiological and growth traits leading to increased biomass. For example, potassium fulvate can increase growth, yield and pod quality of beans. Studies have concluded that it promotes seedling rooting & seed germination by stimulating plant metabolism and absorption of nutrients. Also appears to help soil aeration and water retention. |
|
Current |
|
- |
|
Potassium fulvate is derived from fulvic acid, which is a component of humic substances |
|
Potassium fulvate is typically produced from natural mineral resources such as leonardite and lignite. The process involves extracting fulvic acid from the mineral using a chemical process. The fulvic acid is then purified and reacted with potassium hydroxide to produce potassium fulvate. |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Not applicable |
|
C₁₄H₁₁KO₈ |
|
CC1(CC2=C(CO1)C(=O)C3=C(O2)C=C(C(=C3C(=O)[O-])O)O)O.[K+] |
|
- |
|
YHMFHOSLKYZBDN-UHFFFAOYSA-M |
|
InChI=1S/C14H12O8.K/c1-14(20)3-8-5(4-21-14)11(16)9-7(22-8)2-6(15)12(17)10(9)13(18)19;/h2,15,17,20H,3-4H2,1H3,(H,18,19);/q;+1/p-1 |
|
Yes |
|
Other substance |
|
Biostimulant - improved nutrient use efficiency & growth enhancement |
|
Plant and animal derived substance; Humic substance biostimulant |
|
- |
|
- |
|
- |
|
Natural |
|
As a biostimulant it is thought to induce beneficial physiological responses via hormone-like signalling pathways. The substance chelates most plant nutrients (N, P, K) and makes them readily available for uptake by plants and subsequently increases soil microorganisms populations. |
|
- |
|
- |
|
- |
|
- |
|
44633028 |
|
346.33 |
|
- |
|
potassium 3,7,8-Trihydroxy-3-methyl-10-oxo-1,4-dihydropyrano[4,3-b]chromene-9-carboxylate |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Dark coloured powdery solid |
|
|
|
|
|
- Ciba Agripharma SARL
- Symbio
|
|
- Kynoch fertiliser
- Symbio Humic Booster
|
|
Usually formulated for use as a foliar spray or with drip irrigation |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
> 1000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Moderate |
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
> 2.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
XNo, known not to cause a problem |
|
|
|
Ingestion may cause gastrointestinal irritation, nausea, vomiting May cause sensitisation by inhalation |
|
|
|
Not compatible with strong oxidizing agents, acids and bases, strong reducing agents and flammable materials Flammable |
|
- |
|
- |
|
- |
|
- |
|
Stable under normal storage conditions. Protect from light and humidity. |
|
|
|
potassium fulvate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
29/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |