Tebuthiuron (Ref: EL 103) |

Last updated: 22/08/2024
|
 |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide used to control a broad range of herbaceous, woody, annual and perennial weeds in non-cropland areas, rights-of-way, and industrial sites |
|
Bluegrass; Chickweed; Clover; Docks; Virginia creeper; Whitethorn; Eastern cottonwood; Chamise; Blackberry; Black higory; Bitternut hickory |
|
Non-crop areas such as paths; roads, right-of-way, industrial sites |
|
- |
|
Current |
|
1975, registered Brazil |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₁₆N₄OS |
|
CC(C)(C)C1=NN=C(S1)N(C)C(=O)NC |
|
- |
|
HBPDKDSFLXWOAE-UHFFFAOYSA-N |
|
InChI=1S/C9H16N4OS/c1-9(2,3)6-11-12-8(15-6)13(5)7(14)10-4/h1-5H3,(H,10,14) |
|
Yes |
|
Herbicide |
|
Urea herbicide; Thiadiazolylurea herbicide |
|
- |
|
- |
|
Synthetic |
|
Systemic, low selectivity, absorbed by roots and translocated. Inhibits photosynthesis (photosystem II). |
|
34014-18-1 |
|
251-793-7 |
|
- |
|
105501 |
|
5383 |
|
616-020-00-3 |
|
228.31 |
|
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-N,N'-dimethylurea |
|
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
|
N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethylurea |
|
Potential groundwater contaminant |
|
- |
|
C2 |
|
7 |
|
Not applicable |
|
Not applicable |
|
- |
|
Off-white to buff coloured crystalline solid |
|
|
|
|
|
- Brush
- Bullet
- Graslan
- Herbic
- Reclaim
- Perflan
- Spike
|
|
Usually supplied as wettable powders, granules or pellets |
|
|
|
|
|
|
|
2500 |
|
High |
|
3700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
6100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
70000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
170000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
|
162.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
275 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
6.17 X 1001 |
Calculated |
- |
|
1.79 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.19 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
0.27 |
|
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
2.47 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
400 |
|
Very persistent |
|
360 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature data. Other sources: 1300 days at 25 °C (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
64 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
Not sensitive to pH |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
80 |
|
Other data: Log Koc 2.1 at 25 °C (R3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
5.36 |
Calculated |
High leachability |
|
|
8.52 X 1000 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
2.6 |
Whole fish |
Low potential |
|
Not available |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
N-(5-[1,1-dimethylethyl]-1,3,4-thiadazol-2-yl)-N'-(hydroxymethyl)-N-methyl urea |
- |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
644 |
Rat |
Moderate |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
800 |
- |
|
- |
- |
- |
|
> 2500 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 690 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source in silicon media |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 30 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 87 |
Oncorhynchus mykiss |
Moderate |
|
9.3 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas growth |
Moderate |
|
- |
- |
- |
|
> 225 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.135 |
Lemna gibba |
Moderate |
|
- |
- |
- |
|
0.05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
644 |
Rat |
Moderate |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
3.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Moderately toxic Blood, liver, pancreas and kidney toxicant |
|
|
|
No information available |
|
Health: H302 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
tebuthiuron |
|
tebuthiuron |
|
Tebuthiuron |
|
tebuthiuron |
|
tebutiuron |
|
tebutiuron |
|
- |
|
tebutiuron |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |