Fluazifop-P (Ref: R156172) |

Last updated: 09/01/2025
|
 |
(Also known as: fluazifop-P acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide that is normally used as the butyl derivative. Also a chemical transformation product |
|
Volunteer cereals, Annual and perennial grass weeds |
|
Soybeans; Carrots; Spinach; Potatoes; Ornamentals |
|
- |
|
Current |
|
1981, first marketed |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
France/Italy |
|
31/05/2026 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
|
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
|
|
|
|
Fluazifop-P is the R-isomer of fluazifop. |
|
C₁₅H₁₂F₃NO₄ |
|
CC(C(=O)O)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
|
C[C@H](C(=O)O)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
|
YUVKUEAFAVKILW-SECBINFHSA-N |
|
InChI=1S/C15H12F3NO4/c1-9(14(20)21)22-11-3-5-12(6-4-11)23-13-7-2-10(8-19-13)15(16,17)18/h2-9H,1H3,(H,20,21)/t9-/m1/s1 |
|
Yes |
|
Herbicide, Metabolite |
|
Soil |
|
Unclassified substance |
|
- |
|
- |
|
Synthetic |
|
Not applicable |
|
83066-88-0 |
|
617-435-2 |
|
467 |
|
Not applicable |
|
- |
|
No data found |
|
327.26 |
|
- |
|
(R)-2-(4-((5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoic acid |
|
(R)-2-(4-((5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy-propanoic acid |
|
- |
|
- |
|
A |
|
1 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless to brown coloured liquid depending on purity |
|
|
|
|
|
|
|
40.5 |
at 25 °C |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.51 X 1003 |
Calculated |
- |
|
3.18 |
|
High |
|
|
Soluble |
|
- |
|
Measured |
|
- |
|
- |
- |
- |
|
3.12 |
|
- |
Weak acid |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
25 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
15 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slow |
|
- |
|
|
Stable |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
|
- |
|
43 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately fast |
|
45 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
7.1 |
|
Moderately mobile |
|
205 |
|
EU dossier Kd range 1.1-13.1 mL g⁻¹, Koc range 106-304 mL g⁻¹, Soils=6 |
|
|
1.10 |
|
Mobile |
|
48.72 |
|
0.64 |
|
EU dossier kf range 0.8-2.1 mL g⁻¹, Kfoc range 38.5-83.6 mL g⁻¹, 1/n range 0.52-0.82, Soils=6 |
|
No |
|
|
|
|
|
3.23 |
Calculated |
High leachability |
|
|
3.24 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat as butyl variant |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 200 |
Apis mellifera as butyl variant |
Low |
|
> 200 |
Apis mellifera as butyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat as butyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.01 |
|
- |
|
0.017 |
|
- |
|
- |
- |
- |
|
0.02 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H361d Environment: H400, H410 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
fluazifop-P |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
09/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |