Cloxyfonac |

Last updated: 03/09/2023
|
 |
(Also known as: hydroxy-MCPA; HMCPA) |
Cloxyfonac is a herbicide usually formulated using the sodium salt. The acid is highly soluble in water and moderately volatile so there is some risk of drift. No information is available regarding its environmental persistence. It is moderately toxic to fish and aquatic invertebrates. Cloxyfonac has a low mammalian oral toxicity but may be a neurotoxicant. It is also a skin, eye and respiratory irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Plant growth regulator which is usually used as the sodium salt. It is also a chemical transformation product |
|
Fruit set and size |
|
Tomatoes; Aubergines |
|
- |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₉ClO₄ |
|
C1=CC(=C(C=C1Cl)CO)OCC(=O)O |
|
- |
|
ZJRUTGDCLVIVRD-UHFFFAOYSA-N |
|
InChI=1S/C9H9ClO4/c10-7-1-2-8(6(3-7)4-11)14-5-9(12)13/h1-3,11H,4-5H2,(H,12,13) |
|
Yes |
|
Herbicide, Plant Growth Regulator, Metabolite |
|
Soil, Animal, Rat |
|
Unclassified pesticide |
|
- |
|
- |
|
Synthetic |
|
- |
|
6386-63-6 |
|
228-987-5 |
|
None allocated |
|
None allocated |
|
22883 |
|
No data found |
|
216.12 |
|
[4-chloro-2-(hydroxymethyl)phenoxy]acetic acid |
|
4-chloro-a-hydroxy-o-tolyloxyacetic acid |
|
2-[4-chloro-2-(hydroxymethyl)phenoxy]acetic acid |
|
- |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
2000 |
at 25 °C |
High |
|
- |
- |
- |
|
- |
- |
- |
|
391.4 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
190.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.15 X 1001 |
Calculated |
- |
|
1.06 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.44 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
0.114 |
|
Moderately volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
2.3 |
Lepomis macrochirus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.29 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
93 |
Lemna minor |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Probably kidney toxicant May cause headache, vomiting and diarrhoea |
|
|
|
IDMG Transport Hazard Class 9 |
|
- |
|
U (Unlikely to present an acute hazard) |
|
UN2811 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
cloxyfonac |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
HMCPA |
|
- |
Record last updated: |
03/09/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |