| Calcium carbonate |

Last updated: 25/10/2025
|
 |
(Also known as: marble dust; calcite; limestone) |
| A multi-use substance predominately used as an animal repellent but which also has some pesticide activity. It has a moderate aqueous solubility but would not be expected to persist in the environment. Calcium carbonate as a low toxicity and is not expected to cause serious health impact but may cause skin and eye irritation. It generally has a low ecotoxicity. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
An inorganic substance mainly used as animal repellent but which also has herbicide, fungicide and/or microbiocide activity. |
|
|
Game - mammals & birds |
|
|
Forestry; Fruit orchards; Deciduous and coniferous trees; Shrubs; Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Withdrawn |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Spain/Hungary |
|
|
31/10/2036 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
CaCO₃ |
|
|
C(=O)([O-])[O-].[Ca+2] |
|
|
No data |
|
|
VTYYLEPIZMXCLO-UHFFFAOYSA-L |
|
|
InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| calcium carbonate |
- |
 |
|
|
Herbicide; Fungicide; Repellent; Other substance |
|
|
pH adjuster; Carrier; Microbiocide |
|
|
Inorganic compound |
|
|
995 g kg⁻¹ |
|
|
- |
|
|
Natural |
|
|
Unappealing texture. Elevates gastric pH. Protective, inhibiting fungal spores and pathogens from entering the host tissues. |
|
|
Calcium carbonate occurs naturally in the earths crust |
|
|
Landscape management |
|
|
Damaging mammals and birds - particularly game |
|
|
Forestry; Fruit orchards; Deciduous and coniferous trees; Shrubs; Ornamentals |
|
|
- |
|
|
471-34-1 |
|
|
207-439-9 |
|
|
843 |
|
|
073502 |
|
|
10112 |
|
|
No data found |
|
|
100.09 |
|
|
calcium carbonate |
|
|
calcium carbonate |
|
|
calcium carbonate |
|
|
calcium carbonate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
Note: Substance is not approved as 'chalk'; EU Low-risk active substance |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
NC |
|
|
- |
|
|
White powder |
|
|
|
|
|
Current |
|
|
Used in agriculture for over 2,000 years |
|
|
|
|
|
- Hubercarb
- Calcabon
- Atomite
- Morsuvin
- FLU17516
|
|
|
Usually supplied as a solution or wettable granules. When used as a repellent it can be applied with a brush to individual plants, shrubs and trees. |
|
|
Calcium carbonate is produced by reacting calcium hydroxide (slaked lime) with carbon dioxide. The resulting product is purified to remove any impurities and dried. It can also be produced manufactured industrially for from chalk, limestone, or marble by either a wet or dry grinding process. |
|
|
The production of calcium carbonate emits approximately 0.30 kg CO₂e per kilogram of product when manufactured under standard industrial conditions. This figure represents the climate footprint at the factory level, including energy use for refinement and processing but excluding downstream emissions like transportation or application. |
|
|
|
|
|
|
|
|
|
|
14.0 |
|
Moderate |
|
|
Insoluble |
Ethanol |
- |
|
|
825 |
|
- |
|
|
Decomposes before boiling |
|
- |
|
|
825 |
|
- |
|
|
- |
- |
- |
|
|
|
Not applicable |
- |
- |
|
|
Not applicable |
|
Not applicable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
2.83 |
|
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Not applicable |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Natural substance that rapidly disperses in the environment |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source expert judgement |
Low |
|
|
> 837 |
Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
343 |
Apis mellifera |
Low |
|
|
337 |
Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 100 |
Oncorhynchus mykiss |
Low |
|
|
> 200 |
Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
> 100 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
<>Desmodesmus subspicatus |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
200 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
167.4 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
6.74 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
1 |
Worst case of temperate acute and chronic fish |
|
|
1 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
10 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 3.0 |
Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Exposure not considered significant - low risk |
|
|
Exposure not considered significant - low risk |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
XNo, known not to cause a problem |
  |
|
|
|
May cause hypotension May cause dose related constipation and/or mild gastrointestinal discomfort May cause kidney damage at very high doses |
|
|
|
|
|
Corrosive Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
|
Health: H315, H318, H319, H335, H336, H372 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
calcium carbonate |
|
|
caronate de calcium |
|
|
Calciumcarbonat |
|
|
calciumkarbonat |
|
|
carbonato di calcio |
|
|
carbonato del calcio |
|
|
- |
|
|
weglan wapnia |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
25/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.