Bilanafos (Ref: MW 801) |
Last updated: 21/02/2024
|
|
(Also known as: AIDS 132579; bialaphos; SF 1293; bilanaphos; bialafos) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A naturally occurring substance that is a protoxin, degrading to glufosinate in the plant. It is usually used as the sodium salt |
|
Annual and perennial weeds |
|
Grapes: Apples; Citrus |
|
- |
|
- |
|
Considered obsolete but may be available in some countries |
|
1984, introduced |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Bilanafos is a chiral molecule. |
|
C₁₁H₂₂N₃O₆P |
|
CC(C(=O)NC(C)C(=O)O)NC(=O)C(CCP(=O)(C)O)N |
|
C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)[C@H](CCP(=O)(C)O)N |
|
GINJFDRNADDBIN-FXQIFTODSA-N |
|
InChI=1S/C11H22N3O6P/c1-6(9(15)14-7(2)11(17)18)13-10(16)8(12)4-5-21(3,19)20/h6-8H,4-5,12H2,1-3H3,(H,13,16)(H,14,15)(H,17,18)(H,19,20)/t6-,7-,8-/m0/s1 |
|
Yes |
|
Herbicide, Peptide |
|
Micro-organism derived substance; Peptide herbicide |
|
- |
|
- |
|
Natural |
|
Pro-toxin. Non-selective, systemic, contact action. Glutamine synthetase inhibitor: accumulates ammonium ions, inhibits photosynthesis. |
|
Isolated from the soil bacterium Streptomyces hygroscopicus (Jensen) Waksman & Henrici and Streptomyces viridochromeogenes (Krainsky) Waksman & Henrici |
|
Produced by controlled fermentation usually as the sodium salt |
|
Crop protection |
|
A wide range of post-emergence annual and perennial broad-leaved weeds in a variety of crops. |
|
Vines, apples, bush fruit and others |
|
- |
|
35597-43-4 |
|
- |
|
None allocated |
|
- |
|
5462314 |
|
323.28 |
|
- |
|
(2S)-2-amino-4-[hydroxy(methyl)phosphinoyl]butyryl-L-alanyl-L-alanine |
|
(2S)-2-amino-4-(hydroxymethylphosphinyl)butanoyl-L-alanyl-L-alanine |
|
- |
|
- |
|
H |
|
10 |
|
Not applicable |
|
Not applicable |
|
- |
|
Solid |
|
|
|
|
- |
- |
|
Usually suplied as a soluble powder or as liquid formulations |
|
|
|
|
|
1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
250000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethanol |
- |
500000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Methanol |
- |
|
160 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
8.71 X 10-03 |
Calculated |
- |
|
-2.06 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.33 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source |
Stable |
|
- |
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
Not pH sensitive |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
Known soil and groundwater metabolites |
|
None
|
|
|
|
|
4-[(hydroxy)(methyl)phosphinyl]butyric acid |
- |
Mice (Faeces) |
- |
- |
glufosinate (Ref: HOE 00661) |
- |
Plant |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
268 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Gallus domesticus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Non-toxic |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinus carpio |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
268 |
Rat |
Moderate |
|
3000 |
Rat |
- |
|
2.57 |
Rat |
- |
|
Intravenous LD₅₀ = 80 mg kg⁻¹ |
Mouse |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No adverse health effects noted |
|
|
|
No information available |
|
Health: H301, H302, H312, H315, H319, H332, H335, H361, H370 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
bilanafos |
|
- |
|
- |
|
bilanafos |
|
bilanafos |
|
bilanafos |
|
- |
|
bilanafos |
|
bilanafos |
|
- |
|
bilanafos |
|
- |
Record last updated: |
21/02/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |