Propylene glycol |

Last updated: 18/01/2024
|
 |
(Also known as: methylethyl glycol; E1520) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
Substance with no pesticidal activity but sometimes used as a solvent or carrier in product formulations. |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable - not a ppp. May be authorised at national level under different legislation |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₃H₈O₂ |
|
CC(CO)O |
|
No data |
|
DNIAPMSPPWPWGF-UHFFFAOYSA-N |
|
InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
|
Yes |
|
Other substance, Veterinary substance |
|
Solvent |
|
Unclassified substance |
|
- |
|
- |
|
Synthetic |
|
Inert |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
57-55-6 |
|
200-338-0 |
|
- |
|
068603 |
|
- |
|
76.09 |
|
- |
|
propane-1,2-diol |
|
1,2-propanediol |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless viscous liquid |
|
|
|
|
|
1000000 |
at 25 °C |
High |
|
Miscible |
Ethanol |
- |
Miscible |
Acetone |
- |
Miscible |
Chloroform |
- |
Miscible |
Ether |
- |
|
-59 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.20 X 10-01 |
Calculated |
- |
|
-0.92 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.036 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
14.9 |
|
- |
Very weak acid |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 20000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
2080 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
710 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Pimephales promelas |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
10000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
> 20000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
20800 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
Mainly eliminated unchanged in the urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Possible liver and kidney toxicant May cause seizures, coma, arrhythmias & cardiorespiratory arrest |
|
|
|
Flammable |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
propylene glycol |
|
- |
|
1,2-Propylenglykol |
|
- |
|
- |
|
- |
|
- |
|
propylenowo-glikolowy |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
18/01/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |