| Kaolin |

Last updated: 25/10/2025
|
 |
(Also known as: argilla; bentone; china clay; porcelain clay; neokaolin ; aluminium silicate hydrate; hydrated aluminium silicate) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
Substance with no pesticidal properties but sometimes used in pesticide product formulations to form a barrier film preventing target pests from reaching plant. |
|
|
Flea beetles; Japanese beetles; Sawflies; Codling moth; Aphids; Weevils; Psyllids; Thrips |
|
|
Fruit including pears, apples, plums, cherries, grapes, berries; Row field crops |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Greece/France |
|
|
31/03/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
  |
✓ |
  |
  |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
  |
✓ |
  |
✓ |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
✓ |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
H₄Al₂O₉Si₂ |
|
|
O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
|
|
- |
|
|
NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
|
|
InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;;; |
|
|
Yes |
|
|
Insecticide; Other substance; Veterinary substance |
|
|
Coating agent |
|
|
Inorganic compound |
|
|
- |
|
|
- |
|
|
Natural |
|
|
For crop protection it mainly has a non-toxic mode of action, acting via its physical properties. It may also interfere with feeding behaviour and egg-laying. For animal health it can bind toxins, bacteria, and excess water in the gut. It adheres to the gastrointestinal mucosa, forming a protective coating that helps prevent the absorption of harmful substances. |
|
|
Substance naturally occurs in various minerals |
|
|
Crop protection |
|
|
Flea beetles; Japanese beetles; Sawflies; Codling moth; Aphids; Weevils; Psyllids; Thrips |
|
|
Fruit including pears, apples, plums, cherries, grapes, berries; Row field crops |
|
|
- |
|
|
1332-58-7 |
|
|
310-194-1 |
|
|
None allocated |
|
|
100104 |
|
|
56841936 |
|
|
No data found |
|
|
258.16 |
|
|
- |
|
|
oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate |
|
|
aluminium silicate hydrate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
Yes [ C2 Criterion 2: Pesticide active ingredients that meet the criteria of carcinogenicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H350) ] |
|
|
Yes [ R02 Rule 2: Pesticide active ingredients that meet the criteria of carcinogenicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H350) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
UNM |
|
|
Not applicable |
|
|
- |
|
|
Off-white coloured powder |
|
|
|
|
|
Current |
|
|
1997, first registered as pesticide USA |
|
|
- Stoller Enterprises Inc.
- Zeotis UK Ltd
- KL Pharmaceutical Ltd
|
|
|
- Surround Crop Protectant
- Kaogel VP Oral Suspension
- KL One Minute Poultice
|
|
|
Usually formulated as a powder, granules, oral suspensions and poultices |
|
|
Kaolin is produced commercially through several key steps. Firstly, kaolin mineral deposits are typically extracted from open-pit mines. The extracted kaolin is mixed with water to create a slurry. This process, known as blunging, helps to break down the clay and remove impurities. The slurry is then screened to remove coarse particles and centrifuged to separate the kaolin from sand and other impurities. Further refinement involves de-gritting, where finer particles are separated from the kaolin slurry. The refined kaolin slurry is filtered to remove excess water and then dried. This can be done using rotary dryers, spray dryers, or filter presses. For certain applications, kaolin may be calcined (heated to high temperatures) to enhance its properties, such as brightness and hardness. The dried kaolin is milled to achieve the desired particle size and consistency. |
|
|
According to emissions modeling based on the ecoinvent database wet-process kaolin production emits approximately 0.13–0.25 kg CO₂e per kg of kaolin produced. |
|
|
|
|
|
|
|
|
|
|
5.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
1760 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Not applicable |
- |
- |
|
|
Not applicable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Not applicable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
2.6 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Kaolin is a non-degradable natural component of the environment |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
Kaolin is a natural component of the environment |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
Low |
|
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 2500 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2500 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2500 |
Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Poorly absorbed from the gastrointestinal tract, has a short half-life and is nearly all excreted unchanged |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Inhalation may cause pneumoconiosis (Kaolinosis) May produce gastrointestinal disturbances as high doses Possible respiratory sensitiser May cause toxic responses via inhalation CLP data - known human carcinogen |
|
|
|
|
|
No information available |
|
|
Health: H315, H319, H334, H335, H350, H370, H372, H373 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
kaolin |
|
|
kaolin |
|
|
Porzellanerde |
|
|
kaolin |
|
|
caolino |
|
|
caolin |
|
|
kaoline |
|
|
- |
|
|
kaolin |
|
|
porcelanfold |
|
|
kaolien |
|
|
- |
| Record last updated: |
25/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |