Kaolin |

Last updated: 13/02/2025
|
 |
(Also known as: argilla; bentone; china clay; porcelain clay; neokaolin ; aluminium silicate hydrate; hydrated aluminium silicate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
Substance with no pesticidal properties but sometimes used in pesticide product formulations to form a barrier film preventing target pests from reaching plant. |
|
Flea beetles; Japanese beetles; Sawflies; Codling moth; Aphids; Weevils; Psyllids; Thrips |
|
Fruit including pears, apples, plums, cherries, grapes, berries; Row field crops |
|
- |
|
- |
|
Current |
|
1997, first registered as pesticide USA |
|
- |
|
Not approved |
|
Not applicable |
|
None |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Greece/France |
|
31/03/2026 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
  |
✓ |
  |
  |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
  |
✓ |
  |
✓ |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
✓ |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
H₄Al₂O₉Si₂ |
|
O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
|
- |
|
NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
|
InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;;; |
|
Yes |
|
Insecticide, Semiochemical, Other substance, Veterinary substance |
|
Coating agent |
|
Inorganic compound |
|
- |
|
- |
|
Natural |
|
Mainly non-toxic mode of action, acts via its physical properties but may also interfere with feeding behaviour and egg-laying |
|
Substance naturally occurs in various minerals |
|
Kaolin is produced commercially through several key steps. Firstly, kaolin mineral deposits are typically extracted from open-pit mines. The extracted kaolin is mixed with water to create a slurry. This process, known as blunging, helps to break down the clay and remove impurities. The slurry is then screened to remove coarse particles and centrifuged to separate the kaolin from sand and other impurities. Further refinement involves de-gritting, where finer particles are separated from the kaolin slurry. The refined kaolin slurry is filtered to remove excess water and then dried. This can be done using rotary dryers, spray dryers, or filter presses. For certain applications, kaolin may be calcined (heated to high temperatures) to enhance its properties, such as brightness and hardness. The dried kaolin is milled to achieve the desired particle size and consistency. |
|
Crop protection |
|
Flea beetles; Japanese beetles; Sawflies; Codling moth; Aphids; Weevils; Psyllids; Thrips |
|
Fruit including pears, apples, plums, cherries, grapes, berries; Row field crops |
|
- |
|
1332-58-7 |
|
310-194-1 |
|
None allocated |
|
100104 |
|
56841936 |
|
No data found |
|
258.16 |
|
- |
|
oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate |
|
aluminium silicate hydrate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Off-white coloured powder |
|
|
|
|
|
5.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
1760 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Not applicable |
- |
- |
|
Not applicable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Not applicable |
|
|
- |
- |
- |
|
- |
- |
- |
|
2.6 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Very persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Kaolin is a non-degradable natural component of the environment |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
Kaolin is a natural component of the environment |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 2000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
Low |
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 2500 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 2500 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 2500 |
Unknown species |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
Poorly absorbed from the gastrointestinal tract, has a short half-life and is nearly all excreted unchanged |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Inhalation may cause pneumoconiosis (Kaolinosis) May produce gastrointestinal disturbances as high doses Possible respiratory sensitiser May cause toxic responses via inhalation CLP data - known human carcinogen |
|
|
|
No information available |
|
Health: H315, H319, H334, H335, H350, H370, H372, H373 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
kaolin |
|
kaolin |
|
Porzellanerde |
|
kaolin |
|
caolino |
|
caolin |
|
kaoline |
|
- |
|
kaolin |
|
porcelanfold |
|
kaolien |
|
- |
Record last updated: |
13/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |