| Jasmone |

Last updated: 18/10/2025
|
 |
(Also known as: (Z)-jasmone; cis-jasmone; oil of jasmine) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
Plant hormone extracted from jasmine flowers that has an insect repellent effect |
|
|
Aphids; Whitefly |
|
|
Wheat; Vegetables; Potatoes; Protected crops |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Jasmone exhibits geometric (cis-trans or E/Z) isomerism due to the presence of a double bond in its pentenyl side chain. This structural feature allows for two distinct isomers: cis-jasmone (Z-jasmone) and trans-jasmone (E-jasmone). |
|
|
C₁₁H₁₆O |
|
|
CCC=CCC1=C(CCC1=O)C |
|
|
CC/C=C\CC1=C(CCC1=O)C |
|
|
XMLSXPIVAXONDL-PLNGDYQASA-N |
|
|
InChI=1S/C11H16O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h4-5H,3,6-8H2,1-2H3/b5-4- |
|
|
Yes |
|
|
Repellent; Insecticide; Other substance |
|
|
Food additive |
|
|
Plant-derived substance |
|
|
>98% |
|
|
- |
|
|
Natural |
|
|
Induces defense response in plants, specific and persistent and has direct signalling roles with plant-feeding aphids. Attracts aphid predators. |
|
|
Extracted from volatile oils found in jasmine (Jasminum) flowers, typically Jasminum grandiflorum or Jasminum sambac are used. |
|
|
Crop protection |
|
|
Aphids; Whitefly |
|
|
Wheat; Vegetables; Potatoes; Protected crops |
|
|
- |
|
|
488-10-8 |
|
|
207-668-4 |
|
|
- |
|
|
130819 |
|
|
- |
|
|
164.25 |
|
|
- |
|
|
3-methyl-2-(cis-2-penten-1-yl)-2-cyclopenten-1-one |
|
|
(Z)-3-methyl-2-(2-pentenyl)-cyclopenten-1-one |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
UNE |
|
|
Not known |
|
|
- |
|
|
Pale straw coloured liquid |
|
|
|
|
|
Current |
|
|
2019, first registered USA |
|
|
- Extrasynthese
- SAFC Global
- Takasago
|
|
|
|
|
|
Final products tend to be clear, mobile liquids |
|
|
The commercial production of jasmone involves several steps. First, the selected Jasmine species are cultivated. The flowers are harvested early in the morning when their fragrance is most potent and oil yields are highest. The essential oil is extracted from the flowers, typically using steam distillation or solvent extraction. The extracted oil contains various compounds, including jasmone. Jasmone is then isolated from the essential oil through processes such as fractional distillation or chromatography. |
|
|
GHG related data for specific plant oils is scarce. However, from publicly available data the carbon footprint of plant oils has been roughly estimated at between 1.0 and 4.0 kg CO₂e per kg of oil. This depends on the plant oil content, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
275 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
107 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
|
3.55 X 1003 |
Calculated |
- |
|
|
3.55 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.94 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
1.33 X 1005 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
500 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
100 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May cause allergic reactions |
|
|
|
|
|
No information available |
|
|
Health: H317 Environment: H410 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
jasmone |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
18/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.