| Farnesene | 
  
Last updated: 23/10/2025
 | 
  | 
(Also known as: beta-farnesene; EBF) | 
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
| Environmental fate | 
Ecotoxicity | 
Human health | 
Highly Hazardous Pesticide | 
|   | 
  | 
 | 
 | 
| 
 | 
Alarm pheromone produced by termites and aphids | 
| 
 | 
Aphids - attracts aphid parasitoids; the lacewing (Chrysoperla carnea) | 
| 
 | 
Vegetables | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
Not approved | 
| 
 | 
Not applicable | 
| 
 | 
No UK approval for use as a plant protection agent | 
| EC Regulation 1107/2009 (repealing 91/414) | 
| 
 | 
Not approved | 
| 
 | 
Not applicable | 
| 
 | 
Not applicable | 
| 
 | 
Not applicable | 
| 
 | 
No | 
| 
 | 
ATAustria  | 
BEBelgium  | 
BGBulgaria  | 
CYCyprus  | 
CZCzech Republic  | 
DEGermany  | 
DKDenmark  | 
EEEstonia  | 
ELGreece  | 
 
|   | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
 
ESSpain  | 
FIFinland  | 
FRFrance  | 
HRCroatia  | 
HUHungary  | 
IEIreland  | 
ITItaly  | 
LTLithuania  | 
LULuxembourg  | 
 
|   | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
 
LVLatvia  | 
MTMalta  | 
NLNetherlands  | 
PLPoland  | 
PTPortugal  | 
RORomania  | 
SESweden  | 
SISlovenia  | 
SKSlovakia  | 
 
|   | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
 
 
 | 
| 
 | 
ISIceland  | 
NONorway  | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
 
|   | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
  | 
 
 
 | 
| 
 | 
Farnesene refers to 6 related compounds: 4 stereoisomers of the alpha-form and 2 of the beta-form. Two of the alpha-isomers occur in nature with (E,E)-form being the most common. Only the E-form of beta-farnesene occurs naturally. | 
| 
 | 
C₁₅H₂₄ | 
| 
 | 
CC(=CCCC(=CCCC(=C)C=C)C)C | 
| 
 | 
CC(=CCC/C(=C/CCC(=C)C=C)/C)C | 
| 
 | 
JSNRRGGBADWTMC-NTCAYCPXSA-N | 
| 
 | 
InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12+ | 
| 
 | 
Yes | 
| 
 | 
Insecticide; Attractant; Plant Growth Regulator | 
| 
 | 
Plant and animal derived substance; Pheromone | 
| 
 | 
>96% | 
| 
 | 
- | 
| 
 | 
Natural | 
| 
 | 
Acts as an attractant to insect predators. It has also been shown to inhibit the activity of urease increasing the availability of nitrogen to plants | 
| 
 | 
Beta-farmesene is a consitutuent of various essential oils, an aphid alarm pheromone and is also produced by some plants, including those of the Solanaceae family | 
| 
 | 
Crop protection | 
| 
 | 
Aphids - attracts aphid parasitoids; the lacewing (Chrysoperla carnea) | 
| 
 | 
Vegetables | 
| 
 | 
- | 
| 
 | 
502-61-4 | 
| 
 | 
242-582-0  | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
5281516 | 
| 
 | 
204.35 | 
| 
 | 
- | 
| 
 | 
(6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene | 
| 
 | 
7,11-dimethyl-3-methylene-1,6,10-dodecatriene  | 
| 
 | 
| UK Poisons List Order 1972 | 
Rotterdam Convention | 
Montreal Protocol | 
 
 | 
 | 
 | 
 
| Stockholm Convention | 
OSPAR | 
EU Water Framework Directive | 
 
 | 
 | 
 | 
 
 
 | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
 | 
- | 
| 
 | 
Yes [ R12 Rule 12: Pesticide active ingredients that are bioaccumulative (where bio-concentration factor (BCF) > 2000 l kg⁻¹ (if BCF is not available, where Log P >=5)) ] | 
| 
 | 
EU Low-risk active substance  | 
| 
 | 
Not applicable | 
| 
 | 
Not applicable | 
| 
 | 
UNM | 
| 
 | 
Not applicable | 
| 
 | 
- | 
| 
 | 
Colourless to pale yellow liquid | 
| 
 | 
 | 
| 
 | 
Current | 
| 
 | 
- | 
| 
 | 
- Amyris Inc.
 - DSM
 - ADL Biopharma
 
  | 
| 
 | 
 | 
| 
 | 
Usually supplied as a liquid concentrate | 
| 
 | 
Naturally, farnesene is synthesised in plants from farnesyl pyrophosphate (FPP). It can be manufactured by microbial fermentation or synthesized directly from FPP by a reaction catalysed by farnesene synthase. | 
| 
 | 
While exact CO₂e values are not published for specific pheromones, some general information is available. The PHERA reported that biotechnological production (e.g. yeast fermentation) of pheromones can reduce GHG emissions by up to 90% compared to traditional chemical synthesis and GHG emissions are typically in the 5 to 10 kg CO₂e per kg of pheromone produced. Other sources suggest that small scale pheromone synthesis typically has emissions in the range 1 – 3 kg CO₂e per kg of pheromone produced. | 
| 
 | 
 
 | 
| 
 | 
 | 
 | 
 | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
25 | 
 | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
110 | 
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source  | 
- | 
| 
 | 
 | 
1.48 X 1007 | 
Calculated | 
- | 
| 
 | 
7.17 | 
 | 
High | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
0.83 | 
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source  | 
- | 
| 
 | 
- | 
- | 
- | 
| - | 
| 
 | 
1346 | 
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source  | 
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
 | 
 | 
| 
 | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. | 
| 
 | 
- | 
| Soil adsorption and mobility | 
 | 
None
| Terrestrial ecotoxicology | 
| 
 | 
 | 
 | 
 | 
| 
 | 
> 5000 | 
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source  Rat | 
Low | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| - | 
| 
 | 
- | 
- | 
- | 
| - | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
 | 
 | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
- | 
- | 
- | 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| HUMAN HEALTH AND PROTECTION | 
 
 | 
 
 | 
| 
 | 
 | 
 | 
 | 
| 
 | 
Low (class I) | 
- | 
- | 
| 
 | 
> 5000 | 
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source  Rat | 
Low | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 -  | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
- | 
- | 
- | 
| 
 | 
 | 
- | 
| 
 | 
Most likely route of exposure is via skin absorption | 
| 
 | 
- | 
- | 
- | 
| 
 | 
| Carcinogen | 
 | 
Endocrine disruptor | 
 
| No data found | 
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data  | 
No data found | 
 
| Reproduction / development effects | 
Acetyl cholinesterase inhibitor | 
Neurotoxicant | 
 
| No data found | 
XNo, known not to cause a problem  | 
No data found | 
 
| Respiratory tract irritant | 
Skin irritant | 
Skin sensitiser | 
 
| No data found | 
?Possibly, status not identified  | 
No data found | 
 
| Eye irritant | 
Phototoxicant | 
  | 
 
?Possibly, status not identified  | 
No data found | 
  | 
 
 
 | 
| 
 | 
May cause allergic reactions | 
| 
 | 
 | 
| 
 | 
No information available | 
| 
 | 
Health: H317 Environment: H410 | 
| 
 | 
Not listed (Not listed) | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
 | 
| 
 | 
farnesene | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| 
 | 
- | 
| Record last updated: | 
23/10/2025 | 
| Contact: | 
aeru@herts.ac.uk | 
| Please cite as: | 
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |