4-allylanisole |
Last updated: 17/08/2023
|
|
(Also known as: p-allylanisole; methyl chavicol; estragol; estragole; 4-allylmethoxybenzene) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A naturally occurring chemical that acts as a beetle repellent when applied to trees by signalling a food and habitat source |
|
- |
|
- |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₁₀H₁₂O |
|
COC1=CC=C(C=C1)CC=C |
|
No data |
|
ZFMSMUAANRJZFM-UHFFFAOYSA-N |
|
InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3,5-8H,1,4H2,2H3 |
|
Yes |
|
Insecticide, Semiochemical, Pheromone, Repellent |
|
Plant derived substance |
|
- |
|
- |
|
Natural |
|
Contact |
|
Produced by certain confier trees in response to wounding or poor environmental conditions and is also present in large quantities in certain herbs such as basil, fennel and tarragon |
|
- |
|
Forestry |
|
Bark beetles including southern pine beetle |
|
Conifer trees |
|
- |
|
140-67-0 |
|
205-427-8 |
|
- |
|
062150 |
|
8815 |
|
148.2 |
|
- |
|
1-methoxy-4-(2-propenyl)benzene |
|
4-allyl-1-methoxybenzene |
|
EC 2232/96 Annex 1 registered as food flavouring agent |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not applicable |
|
- |
|
Colourless liquid with an aniseed odour |
|
|
|
|
Beetleball Technical |
Taensa, Inc. |
|
- |
|
|
|
|
|
178 |
at 25 °C |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.95 X 1003 |
Calculated |
- |
|
3.47 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.965 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1230 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
R2 R = Peer reviewed scientific publications 2 = Unverified data of unknown source Toxic |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
R2 R = Peer reviewed scientific publications 2 = Unverified data of unknown source Toxic |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1230 |
Rat |
Moderate |
|
5000 |
Rabbit |
- |
|
- |
- |
- |
|
Intraperitoneal LD₅₀ = 1030 mg kg⁻¹ |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Exposure may occur via skin or inhalation - PPE/PPC advised |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
May cause dermatitis May cause gastrointestinal irritation with nausea, vomiting and diarrhoea Genotoxic CLP data - suspected carcinogen |
|
|
|
Flammable Incompatible with strong oxidizing agents |
|
Health: H302, H315, H317, H319, H341, H351 Environment: H412 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
4-allylanisole |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
17/08/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |