| Mepiquat |

Last updated: 02/11/2025
|
 |
(Also known as: mepiquat ion) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A plant growth regulator used to reduce vegetative growth. It is usually used as the chloride salt. |
|
|
Growth - slows growth processes |
|
|
Cereals including wheat, oats, barley, rye, triticale; Grass; Onions; Leeks; Garlic |
|
|
- |
|
|
- |
|
|
- |
|
|
Approved |
|
|
28/02/2029 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Finland/Estonia |
|
|
29/02/2040 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
  |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
✓ |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₇H₁₆N |
|
|
C[N+]1(CCCCC1)C |
|
|
- |
|
|
NNCAWEWCFVZOGF-UHFFFAOYSA-N |
|
|
InChI=1S/C7H16N/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3/q+1 |
|
|
Yes |
|
|
Plant Growth Regulator; Herbicide |
|
|
Quarternary ammonium PGR |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Gibberellin biosynthesis inhibitor |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
15302-91-7 |
|
|
604-881-8 |
|
|
440 |
|
|
- |
|
|
18743 |
|
|
No data found |
|
|
114.21 |
|
|
1,1-dimethylpiperidin-1-ium |
|
|
1,1-dimethylpiperidinium |
|
|
1,1-dimethylpiperidinium |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not known |
|
|
Not known |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Solid |
|
|
|
|
|
|
|
|
Current |
|
|
1980, introduced |
|
|
- BASF
- Anpon
- Barclay
- United AgriProducts
|
|
|
- Canopy
- Cyclade
- Barclay Banshee
|
|
|
Usually formulated as the chloride variant typically as a soluble liquid concentrate |
|
|
Mepiquat, usually produced as the chloride variant, is commercially produced by quaternizing N-methylpiperidine with methylating agents such as methyl chloride or dimethyl sulphate. The synthesis begins with N-methylpiperidine, which undergoes alkylation using a methylating agent under controlled temperature and pressure, typically in a solvent like acetonitrile or ethanol. The reaction yields 1,1-dimethylpiperidinium chloride. |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.82 X 10-04 |
Calculated |
- |
|
|
-3.55 |
as acid |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
3.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.8-4.3, 2 field crops, whole plant matrix, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1490 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
> 155 |
Rat Reproductive NOAEL as chloride variant |
Moderate |
|
|
> 2000 |
Colinus virginianus as chloride variant |
Low |
|
|
- |
- |
- |
|
|
> 100.7 |
Coturnix japonica as chloride variant NOAEL |
Moderate |
|
|
> 3195 |
Eisenia foetida as chloride variant |
Low |
|
|
31.25 |
Eisenia foetida as chloride variant |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 100 |
as chloride variant |
Low |
|
|
> 107.4 |
as chloride variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
Oncorhynchus mykiss as chloride variant |
Low |
|
|
100 |
Oncorhynchus mykiss as chloride variant |
Low |
|
|
- |
- |
- |
|
|
68.5 |
Daphnia magna as chloride variant |
Moderate |
|
|
12.5 |
Daphnia magna as chloride variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
15.4 |
Lemna gibba as chloride variant |
Low |
|
|
- |
- |
- |
|
|
48.2 |
Anabaena flos-aquae as chloride variant |
Low |
|
|
4.6 |
Anabaena flos-aquae as chloride variant |
Low |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1490 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.2 |
|
- |
|
|
0.3 |
|
- |
|
|
- |
- |
- |
|
|
0.3 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Minimal risk from dietary exposure Risk assessment indicates ARfD would not normally be exceded |
|
|
Risk of exposure acceptable under label recommendations for use for personal protection clothing and equipment |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
Moderately toxic |
|
|
|
|
|
Prevent generation of mists |
|
|
Health: H302 Environment: H412 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
mepiquat |
|
|
mepiquat |
|
|
Mepiquat |
|
|
mepiquat |
|
|
mepiquat |
|
|
mepicuat |
|
|
- |
|
|
mepikwatu |
|
|
mepikvat |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
02/11/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |