| Potassium bicarbonate |

Last updated: 13/03/2026
|
 |
(Also known as: potassium acid carbonate; potassium hydrogen carbonate) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
Naturally occurring substance used for the control of several important fungal diseases of fruit and vegetables |
|
|
Powdery mildew; Blight; Anthracnose, Grey mould |
|
|
Fruit including grapes, strawberries; apples; Vegetables; Aubergine; Tomatoes; Hemp |
|
|
Products have been available in the EU for over 10 years and assessed inline with Uniform Principles |
|
|
- |
|
|
- |
|
|
Approved as a commodity substance and via COPR |
|
|
31/08/2027 |
|
|
None |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Netherlands/Greece |
|
|
31/10/2036 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
  |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
  |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
KHCO₃ |
|
|
C(=O)(O)[O-].[K+] |
|
|
- |
|
|
TYJJADVDDVDEDZ-UHFFFAOYSA-M |
|
|
InChI=1S/CH2O3.K/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| potassium bicarbonate |
- |
 |
|
|
Fungicide |
|
|
Inorganic compound |
|
|
99.5% |
|
|
EU dossier - Arsenic < 3 mg kg⁻¹; Lead < 10 mg kg⁻¹ |
|
|
Natural |
|
|
Protectant and eradicant, bicarbonate causes the collapse of hyphal walls and shrinkage of fungal conidia |
|
|
Potassium bicarbonate occurs naturally in salt beds, sea water, silicate rocks, and a number of foods, primarily fruits and vegetables |
|
|
Crop protection |
|
|
- |
|
|
298-14-6 |
|
|
206-059-0 |
|
|
853 |
|
|
073508 |
|
|
516893 |
|
|
No data found |
|
|
100.12 |
|
|
- |
|
|
potassium hydrogen carbonate |
|
|
carbonic acid, monopotassium salt |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
Permitted in organic systems, UK Basic commodity substance implemented under the UK's Plant Protection Products Regulations 2011; EU Low-risk active substance |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
NC |
|
|
- |
|
|
White granules, crystals or powder |
|
|
|
|
|
Current |
|
|
1994, introduced USA |
|
|
- Bioworks Inc.
- Hellena Chemical Company
- Certis
- Arysta LifeScience North America LLC.
- BioWorks, Inc.
|
|
|
- Armicarb 100
- Eco-mate Armicarb O
- Milstop
- Carb-O-Nator
- Kaligreen
- MilStop
|
|
|
Usually supplied as a soluble powder |
|
|
Produced commercially by passing carbon dioxide through an aqueous potassium carbonate solution. |
|
|
The estimated GHG emissions from the commercial production of potassium bicarbonate are approximately 0.5 to 1.2 kg CO₂e per kg of product. This range reflects typical industrial processes where potassium carbonate or potassium hydroxide is reacted with carbon dioxide in aqueous solution. |
|
|
|
|
|
|
|
332000 |
|
High |
|
|
20000 |
n-Heptane |
- |
| 10000 |
Toluene |
- |
| 10000 |
Methanol |
- |
| 10000 |
Ethyl acetate |
- |
|
|
292 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
>156 |
|
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
2.17 |
|
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature quotes very rapid degradation especially in the presence of water |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Very mobile |
|
|
1.0 |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2064 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 368 |
Apis mellifera |
Low |
|
|
> 24 |
Apis mellifera as sodium salt |
Moderate |
|
|
- |
- |
- |
|
|
272.64 |
Apis mellifera |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 7438 |
Aphidius rhopalosiphi |
Low |
|
|
5568 |
Typhlodromus pyri |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 1200 |
Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 860 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Low risk |
- |
|
|
271.86 |
Chironomus riparius 48 hr EC₅₀ |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 87.5 |
Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
206.4 |
Worst case of acute and chronic mammals |
|
|
100 |
Worst case of acute and chronic birds |
|
|
100 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
0.48 |
Worst case of contact and oral honeybees |
|
|
2784 |
Worst case of parasitic wasps and predatory mites |
|
|
12 |
Worst case of temperate acute and chronic fish |
|
|
8.6 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
8.75 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2064 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 4.88 |
Rat 4 hr (whole body) |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
128 |
|
- |
|
|
10-50 |
concentration dependent |
- |
|
|
- |
- |
- |
|
|
|
No identified risks |
|
|
No identified risks |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
No further information available |
|
|
|
|
|
Not flammable, explosive or oxidising |
|
|
Health: H319, H335 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
potassium bicarbonate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
13/03/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.