Multistriatin |

Last updated: 12/02/2025
|
 |
(Also known as: European elm bark beetle sex pheromone) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A volatile substance that is an insect sex pheromone used as an insect attractant |
|
European elm bark beetle (Scolytus multistriatus) |
|
Elm trees |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Multistriatin is a complex chiral molecule. The compound exists in several diastereomic forms, depending on the positions of the methyl groups. Only alpha-multistriatin, attracts the elm bark beetles |
|
C₁₀H₁₈O₂ |
|
CCC12C(CC(C(O1)CO2)C)C |
|
CC[C@]12[C@H](C[C@H]([C@H](O1)CO2)C)C |
|
YMBRJMLOGNZRFY-UTINFBMNSA-N |
|
InChI=1S/C10H18O2/c1-4-10-8(3)5-7(2)9(12-10)6-11-10/h7-9H,4-6H2,1-3H3/t7-,8+,9+,10+/m1/s1 |
|
Yes |
|
Insecticide, Semiochemical |
|
Pheromone |
|
- |
|
- |
|
Natural |
|
Functions as an insect attractant - mating disrupter & lure |
|
A chemical released by virgin female European elm bark beetles (Scolytus multistriatus (Marsham)) |
|
The synthesis of multistriatin begins with a suitable starting material, often a long-chain alkene or alkyne which undergoes hydroformylation, a process that adds a formyl group (CHO) to the carbon chain, resulting in an aldehyde intermediate. The aldehyde intermediate is then reduced to the corresponding alcohol using a reducing agent such as sodium borohydride or lithium aluminium hydride. The resulting alcohol then undergoes cyclization to form the bicyclic structure characteristic of multistriatin before being purified. |
|
Forestry; Woodland management |
|
European elm bark beetle (Scolytus multistriatus) |
|
Elm trees |
|
- |
|
54815-06-4 |
|
- |
|
- |
|
118001 |
|
- |
|
170 |
|
- |
|
- |
|
2,4-dimethyl-5-ethyl-6,8-dioxabicyclo[3.2.1]octane |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not applicable |
|
- |
|
Volatile colourless liquid |
|
|
|
|
|
|
- |
- |
|
Usually sold as the attractant in moth traps that contain a sticky surface or contact insecticide |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
Q4 Q = Miscellaneous data from online sources 4 = Verified data No adverse effects identified or expected |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
No adverse human health effects noted |
|
|
|
Not explosive or oxisiding |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
multistriatin |
|
- |
|
- |
|
- |
|
- |
|
multistriatina |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
12/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |