| Maple lactone |

Last updated: 13/03/2026
|
 |
(Also known as: cyclotene; corylone) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A naturally occuring insect attractant |
|
|
Cockroaches |
|
|
Amenity areas; Domestic situations |
|
|
- |
|
|
- |
|
|
Class: Magnoliopsida; Order: Sapindales: Family: Sapindaceae |
|
|
Not approved |
|
|
not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Maple lactone exhibits tautomeric isomerism a dynamic form of structural isomerism where the compound exists in equilibrium between two forms: a keto form and an enol form. In this case, the enol tautomer (which includes a hydroxyl group and a double bond within the ring) is strongly favoured over the diketone structure due to resonance stabilization and hydrogen bonding. |
|
|
C₆H₈O₂ |
|
|
CC1=C(C(=O)CC1)O |
|
|
- |
|
|
- |
|
|
InChI=1S/C6H8O2/c1-4-2-3-5(7)6(4)8/h8H,2-3H2,1H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| maple lactone |
- |
 |
|
|
Insecticide; Attractant |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Substance odour is attractive to insects |
|
|
- |
|
|
Naturally occurring chemical found in the sap of various trees of the Acer genus |
|
|
Public health |
|
|
- |
|
|
80-71-7 |
|
|
765-70-8 |
|
|
201-303-2 |
|
|
- |
|
|
004049 |
|
|
- |
|
|
112.13 |
|
|
- |
|
|
2-hydroxy-3-methylcyclopent-2-en-1-one |
|
|
2-hydroxy-3-methylcyclopent-2-enone |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=2700; FLAVIS=09.841 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Thick liquid comprised mainly of mainly methyl cyclopentenolone with small quanitities of other lactones. It has a stale odour. |
|
|
|
|
|
Current |
|
|
1998, first registered USA |
|
|
- Babolna Bioenvironmental Centre Ltd.
|
|
|
|
|
|
Usually supplied in formulations for use inside traps |
|
|
Extracted directly from Acer trees or synthesised by a modified acyloin condensation of esters of 2-methyl glutaric acid in which oxygen is introduced in a specific manner to the reaction system |
|
|
- |
|
|
|
|
|
|
|
26800 |
|
High |
|
|
- |
- |
- |
|
|
105.6 |
|
- |
|
|
Decomposes before boiling |
|
- |
|
|
- |
- |
- |
|
|
84.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
2.51 X 1000 |
Calculated |
- |
|
|
0.4 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.151 |
|
- |
|
|
9.21 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Readily biodegradable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1067 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 93.9 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
30.05 |
Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
106.7 |
Worst case of acute and chronic mammals |
|
|
200 |
Worst case of acute and chronic birds |
|
|
100 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
1 |
Worst case of temperate acute and chronic fish |
|
|
0.939 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
3.005 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 1067 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Intraperitoneal LDLo = 500 mg kg⁻¹ |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
  |
|
|
|
May cause allergic reactions |
|
|
|
|
|
Slightly corrosive |
|
|
Health: H315, H319, H334, H335 |
|
|
Not listed |
|
|
Not regulated |
|
|
- |
|
|
- |
|
|
|
|
|
maple lactone |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
13/03/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.