Mildiomycin (Ref: AR-1F1870) |
Last updated: 17/11/2022
|
|
(Also known as: antibiotic B-98891; TF-138) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A peptidyl nucleoside antibiotic with strong activity against plant powdery mildew disease. |
|
Powdery mildew |
|
- |
|
- |
|
- |
|
- |
|
1979, fungal properties first described |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Mildiomycin is a chiral molecule |
|
C₁₉H₃₀N₈O₉ |
|
C1=CC(OC(C1NC(=O)C(CO)N)C(CC(CN=C(N)N)O)(C(=O)O)O)N2C=C(C(=NC2=O)N)CO |
|
- |
|
QKJJCZYFXJCKRX-UHFFFAOYSA-N |
|
InChI=1S/C19H30N8O9/c20-10(7-29)15(31)25-11-1-2-12(27-5-8(6-28)14(21)26-18(27)34)36-13(11)19(35,16(32)33)3-9(30)4-24-17(22)23/h1-2,5,9-13,28-30,35H,3-4,6-7,20H2,(H,25,31)(H,32,33)(H2,21,26,34)(H4,22,23,24) |
|
Yes |
|
Fungicide |
|
Micro-organism |
|
- |
|
- |
|
Natural |
|
Thought to inhibit fungal protein biosynthesis |
|
A substance produced naturally by the soil actinomycetes Streptoverticillium rimofaciens strain B-98891 |
|
Produced commerically by controlled fermentation |
|
Crop protection |
|
Powdery mildews |
|
Ornamentals |
|
- |
|
67527-71-3 |
|
614-077-9 |
|
- |
|
- |
|
- |
|
514.49 |
|
- |
|
4-amino-1-[4-[[(S)-2-amino-3-hydroxy-1-oxopropyl]amino]-9-guanidino-6-carboxy-2,3,4,7,9-pentadeoxy-a-L-talo-nona-2-enopyranosyl]-5-(hydroxymethyl)pyrimidin-2(1H)-one |
|
(S)-4-amino-1-[4-[(2-amino-3-hydroxy-1-oxopropyl)amino]-9-[(aminoiminomethyl)amino]-6-C-carboxy-2,3,4,7,9-pentadeoxy-a-L-talo-non-2-enopyranosyl]-5-(hydroxymethyl)-2(1H)-pyrimidinone |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
Hygroscopic white solid |
|
|
|
|
None identified |
None identified |
|
Usually formulated as a wettable powder and used as a foliar spray |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
>300 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
2.8 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
Weak base, PKa(2) = 4.3, PKa(3) = 7.2 |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 4120 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Low |
|
> 100 |
Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinus carpio |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphia pulex |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
8.05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Selenastrum capricornutum |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 4120 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
Intraperitoneal LD₅₀ = 679 mg kg⁻¹ |
Rat |
- |
Intravenous LD₅₀ = 500 mg kg⁻¹ |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
No further information available |
|
|
|
Hygroscopic |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
mildiomycin |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
17/11/2022 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |