Octenol |
Last updated: 21/06/2023
|
|
(Also known as: amylvinylcarbinol; vinyl amy carbinol; mushroom alcohol; matsuica alcohol; 1-octen-3-ol) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A plant derived insect attractant/repellent used to control mainly flying pests |
|
Flies; Bugs; Mosquitoes |
|
Non-food situations and crops |
|
- |
|
- |
|
Current |
|
1996, first registered USA |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Isomeric existing as two enantiomers: (R)-(–)-1-octen-3-ol and (S)-(+)-1-octen-3-ol. |
|
C₈H₁₆O |
|
CCCCCC(C=C)O |
|
- |
|
VSMOENVRRABVKN-UHFFFAOYSA-N |
|
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3 |
|
Yes |
|
Insecticide, Pheromone, Attractant, Repellent |
|
Plant derived substance |
|
- |
|
- |
|
Natural |
|
Mode of action is unclear but thought to block the insects octenol odorant receptors |
|
Octenol is produced by several plants and fungi, including edible mushrooms |
|
Maufactered for use as an insect repellent |
|
Non-food use |
|
Certain species of mosquitoes and biting flies |
|
- |
|
- |
|
3391-86-4 |
|
222-226-0 |
|
- |
|
069037 |
|
18827 |
|
128.21 |
|
- |
|
oct-1-en-3-ol |
|
3-hydroxy-1-octene |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not applicable |
|
- |
|
- |
|
|
|
|
Octenol lure |
AgriSense BCS Ltd |
Mosquito Magnet |
American Biophysics Corporation |
Mosquito Attractant Emitter Strip |
Hercon Environmental Corp |
|
Usually formulated to use in dispensers, lures and electric bug killing stations |
|
|
|
|
|
1836 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source at 25 °C |
High |
|
- |
- |
- |
|
- |
- |
- |
|
174 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
61.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
4.37 X 1002 |
Calculated |
- |
|
2.64 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
340 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
340 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Moderate |
|
3300 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
3.72 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
Intravenous LD₅₀ = 56 mg kg⁻¹ |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Mouse |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No further information available |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
- |
|
Not listed (Not listed) |
|
UN2810 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
octenol |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
21/06/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |