| Ryanodine |

Last updated: 19/02/2026
|
 |
(Also known as: ryania extract; bonide ryatox; ryanocide; ryania) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
Plant derived alkaloid that has insecticidal properties and used to control insect pests on fruit and some other crops |
|
|
Codling moth; European corn borer; Citrus thrips |
|
|
Maize; Top fruit; Citrus fruit |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Ryanodine is a chiral molecule with three structural isomers |
|
|
C₂₅H₃₅NO₉ |
|
|
CC1CCC2(C3(CC4(C5(C(C(C3(C5(C2(C1O)O4)O)O)OC(=O)C6=CC=CN6)(C(C)C)O)C)O)C)O |
|
|
C[C@H]1CC[C@@]2([C@@]3(C[C@]4([C@@]5([C@]([C@H]([C@@]3([C@]5([C@]2([C@@H]1O)O4)O)O)OC(=O)C6=CC=CN6)(C(C)C)O)C)O)C)O |
|
|
JJSYXNQGLHBRRK-SFEDZAPPSA-N |
|
|
InChI=1/C25H35NO9/c1-12(2)22(31)17(34-16(28)14-7-6-10-26-14)23(32)18(4)11-21(30)19(22,5)25(23,33)24(35-21)15(27)13(3)8-9-20(18,24)29/h6-7,10,12-13,15,17,26-27,29-33H,8-9,11H2,1-5H3/t13-,15+,17+,18-,19-,20-,21-,22+,23+,24+,25+/m0/s1 |
|
|
Yes |
|
|
Insecticide |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Thought to effect muscle movement by binding to the calcium channels in the sarcoplastic reticulum that eventually leads to death |
|
|
- |
|
|
An alkaloid orginially extracted from the stems of various Ryania species including Ryania speciosa which are found in tropical America |
|
|
Crop protection |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
15662-33-6 |
|
|
8047-13-0; 1361-01-9; 1580-06-9; 25800-57-1; 15800-60-9; 94513-55-0 |
|
|
239-732-2 |
|
|
- |
|
|
8047-13-0 |
|
|
- |
|
|
493.61 |
|
|
- |
|
|
1H-pyrrole-2-carboxylic acid, (3S,4R,4aR,6S,7S,8R,8aS,8bR,9S,9aS)-dodecahydro-4,6,7,8a,8b,9a-hexahydroxy-3,6a,9-trimethyl-7-(1-methylethyl)-6,9-methanobenzo[1,2]pentaleno[1,6-bc]furan-8-yl ester |
|
|
3-(1H-pyrrole-2-carboxylate) ryanodol |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R09 Rule 9: Pesticide active ingredients that have demonstrated a high aquatic toxicity (where acute ecotoxicity for fish, invertebrates or algae =< 0.1 mg l⁻¹) ] |
|
|
1945 Patent No. 2,400,295 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
White to off-white solid |
|
|
|
|
|
|
|
|
Considered obsolete but may be available in some countries |
|
|
1940s discovered, 1968; first registered USA |
|
|
- AgriSystems International
- Dunhill Chemicals
|
|
|
- Natur-Gro R-50
- Ryan 50
- Ryania
|
|
|
Usually supplied as a water dispersible powder and applied during insect attack |
|
|
Ryanodine is extracted from the tropical shrub Ryania speciosa. Plants are cultivated and harvested. The stems and roots of the plant are the primary sources of ryanodine. The harvested plant material is dried and ground into a powder. The ryanodine is then extracted using solvents such as ethanol or methanol. The crude extract undergoes several purification steps, including filtration and chromatography, to isolate pure ryanodine. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
16000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
29000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source DMSO |
- |
|
|
219 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
426 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
5.62 X 1001 |
Calculated |
- |
|
|
1.75 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
| Known soil and groundwater metabolites |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1200 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
50 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 104 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 15.7 |
E4 E = Manufacturers safety data sheets 4 = Verified data Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.044 |
Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
120 |
Worst case of acute and chronic mammals |
|
|
10 |
Worst case of acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.157 |
Worst case of temperate acute and chronic fish |
|
|
0.00044 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 1200 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rabbit |
- |
|
|
> 5.1 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
|
Intraperitoneal LD₅₀ = 0.32 mg kg⁻¹ |
Rat |
- |
| Intravenous LDLo = 0.02 mg kg⁻¹ |
Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
May cause muscle weakness Possible lung, thorax and respiratory system toxicant May cause gastrointestinal problems |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
- |
|
|
Not classified: Obsolete |
|
|
UN1544 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
ryanodine |
|
|
ryanodine |
|
|
Ryanodin |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
rianodyna |
|
|
- |
|
|
rianodin |
|
|
ryanodine |
|
|
- |
| Record last updated: |
19/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.