| (E,E)-dodeca-8,10-dienyl-acetate |

Last updated: 18/09/2025
|
 |
(Also known as: Straight Chain Lepidopteran Pheromone; SCLP; Pea moth sex pheromone; Cydia nigricana pheromone) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
A volatile substance that is classed as a Straight Chain Lepidopteran Pheromone (SCLP) and used as an insect attractant |
|
|
Pea moth (Cydia nigricana) |
|
|
Legumes including peas |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
(E,E)-dodeca-8,10-dienyl acetate exhibits geometric (E/Z) isomerism, a form of stereoisomerism that arises from the presence of two carbon–carbon double bonds located at positions 8 and 10 in its 12-carbon chain. |
|
|
C₁₄H₂₄O₂ |
|
|
CC=CC=CCCCCCCCOC(=O)C |
|
|
C/C=C/C=C/CCCCCCCOC(=O)C |
|
|
NTKDSWPSEFZZOZ-VNKDHWASSA-N |
|
|
InChI=1S/C14H24O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h3-6H,7-13H2,1-2H3/b4-3+,6-5+ |
|
|
No |
|
|
Insecticide; Semiochemical |
|
|
Pheromone |
|
|
>95.0% |
|
|
- |
|
|
Natural |
|
|
Functions as an insect attractant - mating disrupter |
|
|
Originally isolated from the female pea moth (Cydia nigricana) |
|
|
Crop protection |
|
|
Pea moth (Cydia nigricana) |
|
|
Legumes including peas |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
53880-51-6 |
|
|
258-834-8 |
|
|
- |
|
|
- |
|
|
- |
|
|
224.34 |
|
|
- |
|
|
- |
|
|
(E,E)-dodeca-8,10-dienyl acetate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow liquid |
|
|
|
|
|
Current |
|
|
- |
|
|
|
|
|
- Pea moth pheromone
- Pea moth monitoring system
|
|
|
Usually supplied in liquid formulations to be used in a slow release pheromone dispenser/trap |
|
|
The commercial production of pheromone attractants and lures involves a sophisticated blend of synthetic chemistry, entomology, and precision engineering. Manufacturers begin by identifying the specific pheromone compounds emitted by target pests, such as sex, aggregation, or alarm pheromones, and then replicate these molecules using chemical synthesis. |
|
|
While exact CO₂e values are not published for specific pheromones, some general information is available. The PHERA reported that biotechnological production (e.g. yeast fermentation) of pheromones can reduce GHG emissions by up to 90% compared to traditional chemical synthesis and GHG emissions are typically in the 5 to 10 kg CO₂e per kg of pheromone produced. Other sources suggest that small scale pheromone synthesis typically has emissions in the range 1 – 3 kg CO₂e per kg of pheromone produced. |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.45 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
No adverse human health issues identified |
|
|
|
|
|
Not explosive or oxisiding |
|
|
- |
|
|
Not listed (Not listed) |
|
|
Not regulated |
|
|
- |
|
|
- |
|
|
|
|
|
(E,E)-dodeca-8,10-dienyl-acetate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
18/09/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |