| Disodium octaborate tetrahydrate |

Last updated: 31/10/2025
|
 |
(Also known as: boron sodium oxide; sodium octaborate; DOT; aquabor) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
A naturally occuring alkaline borate that may be used as an insecticide, fungicide and wood preservative |
|
|
Termites; Powder post beetles; Carpenter ants; Fungi and algae; Molluscs; Mildew |
|
|
Non-food areas |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
B₈H₈Na₂O₁₇ |
|
|
B(=O)OB1OB2OB(OB(OB(O2)OB(O1)OB=O)[O-])[O-].O.O.O.O.[Na+].[Na+] |
|
|
- |
|
|
RDMZIKMKSGCBKK-UHFFFAOYSA-N |
|
|
InChI=1S/B8O13.2Na.4H2O/c9-1-13-5-18-6(14-2-10)20-8-17-4(12)15-3(11)16-7(19-5)21-8;;;;;;/h;;;4*1H2/q-2;2*+1;;;; |
|
|
Yes |
|
|
Insecticide; Fungicide; Other substance |
|
|
Biocide; Wood preservative; Slimicide; Disinfectant; Algicide |
|
|
Inorganic compound |
|
|
>97.5% |
|
|
None declared in dossier prepared for Directive 98/8/EC |
|
|
Natural |
|
|
Mechanism depends on action: antifeed for insects distrupting insect enzyme & digestive systems |
|
|
Naturally occurring mineral that exist in trace amounts in rock, soil, water and all plant and animal life |
|
|
Non-food pest management; Wood preservation |
|
|
Termites; Powder post beetles; Carpenter ants; Fungi and algae; Molluscs; Mildew |
|
|
Non-food areas |
|
|
- |
|
|
12280-03-4 |
|
|
234-541-0 |
|
|
None allocated |
|
|
011103 |
|
|
No data |
|
|
No data found |
|
|
412.53 |
|
|
- |
|
|
boric acid, disodium salt tetrahydrate |
|
|
disodium octaborate tetrahydrate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
Yes [ C4 Criterion 4: Pesticide active ingredients that meet the criteria of reproductive toxicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H360) ] |
|
|
Yes [ R04 Rule 4: Pesticide active ingredients that meet the criteria of reproductive toxicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H360) ] |
|
|
Biocide |
|
|
Not known |
|
|
Not known |
|
|
8D |
|
|
NC |
|
|
- |
|
|
White, odourless powder |
|
|
|
|
|
|
|
|
Current |
|
|
1990, first use as wood preservative, USA; 1983, registered USA for cockroach control |
|
|
- U.S. Borax Inc.
- Dow AgroSciences
|
|
|
- Boracare
- Tim-Bor
- Borathor
- Termite Prufe
- Board Defense
|
|
|
As a wood preservative it is supplied in formulations suitable for application via vacuum pressure, dipping, injection and spraying |
|
|
Produced synthetically for commerical use often via combining boric acid, a sodium-containing chemical product, water and an impurity removal agent in a reactor |
|
|
- |
|
|
|
|
|
|
|
223650 |
|
High |
|
|
- |
- |
- |
|
|
803 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.874 |
at 22 °C |
- |
|
|
9.0 |
|
- |
| Data for boric acid @ 25 DegC |
|
|
1.0 X 10-02 |
|
Low volatility |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
No absorption maxima found in range 190-500nm. |
|
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
Stable at all environmentally relevant pHs |
|
|
|
Stable |
|
Stable |
|
|
Stable at all environmentally relevant pHs |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
2.6 |
|
- |
|
|
- |
|
|
0.83 |
|
|
EU Dossier Kf range 0.4-8.41, 1/n range 0.726-0.955 |
|
|
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 527 |
Colinus virginianus as mg B/kg |
Moderate |
|
|
> 983 mg B/kg bw/day |
Colinus virginianus |
- |
|
|
- |
- |
- |
|
|
473 |
Lumbricus terrestris as mg B/kg |
Moderate |
|
|
54 |
Eisenia andrei as mg B/kg |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 362 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
125 |
Catostomus latipinnis as mg B/L |
Low |
|
|
1.8 |
Danio rerio 34 day as mg B/L |
Moderate |
|
|
- |
- |
- |
|
|
141 |
Daphnia magna as mg B/L |
Low |
|
|
10 |
Daphnia magna 21 day as mg B/L |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
17.5 |
Raphidocelis subcapitata as boron |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
200 |
Worst case of acute and chronic mammals |
|
|
52.7 |
Worst case of acute and chronic birds |
|
|
10.8 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
7.24 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.18 |
Worst case of temperate acute and chronic fish |
|
|
1 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
1.75 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 2.0 |
Rat |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Excreted almost exclusively in the urine as the parent substance |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
Slightly toxic, may cause gastro-intestinal problems May cause metabolism disorders Possible testes toxicant |
|
|
|
|
|
Flame retardant- non-flammable Not explosive or oxidising Not expected to auto-ignite |
|
|
Health: H360FD |
|
|
Not listed (Not listed) |
|
|
Not regulated |
|
|
- |
|
|
- |
|
|
|
|
|
disodium octaborate tetrahydrate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
31/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |